2003-06-16 17:37:11 +00:00
|
|
|
/* GIF saving file filter for The GIMP version 1.3/1.4
|
1997-11-24 22:05:25 +00:00
|
|
|
*
|
2003-06-16 17:37:11 +00:00
|
|
|
* Copyright
|
1998-03-16 10:05:41 +00:00
|
|
|
* - Adam D. Moss
|
|
|
|
* - Peter Mattis
|
|
|
|
* - Spencer Kimball
|
1997-11-24 22:05:25 +00:00
|
|
|
*
|
1998-03-16 10:05:41 +00:00
|
|
|
* Based around original GIF code by David Koblas.
|
1997-11-24 22:05:25 +00:00
|
|
|
*
|
|
|
|
*
|
2003-06-16 17:37:11 +00:00
|
|
|
* Version 4.1.0 - 2003-06-16
|
1998-03-16 10:05:41 +00:00
|
|
|
* Adam D. Moss - <adam@gimp.org> <adam@foxbox.org>
|
1997-11-24 22:05:25 +00:00
|
|
|
*/
|
|
|
|
/*
|
|
|
|
* This filter uses code taken from the "giftopnm" and "ppmtogif" programs
|
|
|
|
* which are part of the "netpbm" package.
|
|
|
|
*/
|
|
|
|
/*
|
|
|
|
* "The Graphics Interchange Format(c) is the Copyright property of
|
|
|
|
* CompuServe Incorporated. GIF(sm) is a Service Mark property of
|
2003-11-06 15:27:05 +00:00
|
|
|
* CompuServe Incorporated."
|
1997-11-24 22:05:25 +00:00
|
|
|
*/
|
2003-05-13 14:59:03 +00:00
|
|
|
/* Copyright notice for GIF code from which this plugin was long ago */
|
|
|
|
/* derived (David Koblas has granted permission to relicense): */
|
|
|
|
/* +-------------------------------------------------------------------+ */
|
|
|
|
/* | Copyright 1990, 1991, 1993, David Koblas. (koblas@extra.com) | */
|
|
|
|
/* +-------------------------------------------------------------------+ */
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/*
|
|
|
|
* REVISION HISTORY
|
|
|
|
*
|
2003-06-16 17:37:11 +00:00
|
|
|
* 2003-06-16
|
|
|
|
* 4.01.00 - Attempt to use the palette colour closest to that of the
|
|
|
|
* GIMP's current brush background colour for the GIF file's
|
|
|
|
* background index hint for non-transparency-aware image
|
|
|
|
* viewers. NOTE that this is merely a hint and may be
|
|
|
|
* ignored by this plugin for various (rare) reasons that
|
|
|
|
* would usually entail writing a somewhat larger image file.
|
|
|
|
* + major version bump to indicate 1.3/1.4 branch.
|
|
|
|
*
|
2003-07-29 06:52:41 +00:00
|
|
|
* 2002/04/24 - Cameron Gregory, http://www.flamingtext.com/
|
|
|
|
* Added no compress option
|
2003-07-29 10:30:55 +00:00
|
|
|
* Added rlecompress(). Should not be covered by lzw patent,
|
2003-07-29 06:52:41 +00:00
|
|
|
* but this is not legal advice.
|
|
|
|
*
|
1999-04-25 16:10:43 +00:00
|
|
|
* 99/04/25
|
1999-11-20 02:20:04 +00:00
|
|
|
* 3.00.02 - Save the comment back onto the image as a persistent
|
1999-04-25 16:10:43 +00:00
|
|
|
* parasite if the comment was edited.
|
|
|
|
*
|
1999-03-30 19:57:08 +00:00
|
|
|
* 99/03/30
|
|
|
|
* 3.00.01 - Round image timing to nearest 10ms instead of
|
|
|
|
* truncating. Insert a mandatory 10ms minimum delay
|
|
|
|
* for the frames of looping animated GIFs, to avoid
|
|
|
|
* generating an evil CPU-sucking animation that 'other'
|
|
|
|
* GIF-animators sometimes like to save.
|
|
|
|
*
|
1999-03-20 17:33:15 +00:00
|
|
|
* 99/03/20
|
|
|
|
* 3.00.00 - GIF-loading code moved to separate plugin.
|
|
|
|
*
|
1999-02-23 00:18:24 +00:00
|
|
|
* 99/02/22
|
|
|
|
* 2.01.02 - Don't show a progress bar when loading non-interactively
|
|
|
|
*
|
1999-01-23 18:49:52 +00:00
|
|
|
* 99/01/23
|
|
|
|
* 2.01.01 - Use a text-box to permit multi-line comments. Don't
|
|
|
|
* try to write comment blocks which are longer than
|
|
|
|
* permitted.
|
|
|
|
*
|
1998-10-09 18:01:35 +00:00
|
|
|
* 98/10/09
|
1999-11-20 02:20:04 +00:00
|
|
|
* 2.01.00 - Added support for persistent GIF Comments through
|
2000-08-22 01:26:57 +00:00
|
|
|
* the GIMP 1.1 GimpParasite mechanism where available.
|
1998-10-09 18:01:35 +00:00
|
|
|
* Did some user-interface tweaks.
|
|
|
|
* Fixed a bug when trying to save a GIF smaller
|
|
|
|
* than five pixels high as interlaced.
|
1998-04-29 10:48:02 +00:00
|
|
|
*
|
1998-09-28 17:14:29 +00:00
|
|
|
* 98/09/28
|
|
|
|
* 2.00.05 - Fixed TigerT's Infinite GIF Bug. Icky one.
|
|
|
|
*
|
1998-09-15 20:34:30 +00:00
|
|
|
* 98/09/15
|
|
|
|
* 2.00.04 - The facility to specify the background colour of
|
|
|
|
* a transparent/animated GIF for non-transparent
|
|
|
|
* viewers now works very much more consistantly.
|
|
|
|
*
|
|
|
|
* The only situations in which it will fail to work
|
|
|
|
* as expected now are those where file size can be reduced
|
|
|
|
* (abeit not by much, as the plugin is sometimes more pessimistic
|
|
|
|
* than it need be) by re-using an existing unused colour
|
|
|
|
* index rather than using another bit per pixel in the
|
|
|
|
* encoded file. That will never be an issue with an image
|
|
|
|
* which was freshly converted from RGB to INDEXED with the
|
|
|
|
* Quantize option, as that option removes any unused colours
|
|
|
|
* from the image.
|
|
|
|
*
|
|
|
|
* Let me know if you find the consistancy/size tradeoff more
|
|
|
|
* annoying than helpful and I can adjust it. IMHO it is too
|
|
|
|
* arcane a feature to present to any user as a runtime option.
|
|
|
|
*
|
1998-05-21 20:26:06 +00:00
|
|
|
* 98/05/18
|
|
|
|
* 2.00.03 - If we did manage to decode at least one frame of a
|
|
|
|
* gif, be sure to display the resulting image even if
|
|
|
|
* it terminated abruptly.
|
|
|
|
*
|
1998-04-29 10:48:02 +00:00
|
|
|
* 98/04/28
|
|
|
|
* 2.00.02 - Fixed a bug with (ms) tag parsing.
|
|
|
|
*
|
1998-03-17 09:39:40 +00:00
|
|
|
* 98/03/16
|
|
|
|
* 2.00.01 - Fixed a long-standing bug when loading GIFs which layer
|
|
|
|
* opaque frames onto transparent ones.
|
|
|
|
*
|
1998-03-16 10:05:41 +00:00
|
|
|
* 98/03/15
|
|
|
|
* 2.00.00 - No longer beta. Uses the current GIMP brush background
|
|
|
|
* colour as the transparent-index colour for viewers that
|
|
|
|
* don't know about transparency, instead of magenta. Note
|
|
|
|
* that this is by no means likely to actually work, but
|
|
|
|
* is more likely to do so if your image has been freshly
|
|
|
|
* to-index'd before saving.
|
|
|
|
*
|
|
|
|
* Also added some analysis to gif-reading to prevent the
|
|
|
|
* number of encoded bits being pumped up inadvertantly for
|
|
|
|
* successive load/saves of the same image. [Adam]
|
|
|
|
*
|
1997-12-12 10:01:21 +00:00
|
|
|
* 97/12/11
|
|
|
|
* 1.99.18 - Bleh. Disposals should specify how the next frame will
|
|
|
|
* be composed with this frame, NOT how this frame will
|
|
|
|
* be composed with the previous frame. Fixed. [Adam]
|
|
|
|
*
|
1997-12-08 00:22:45 +00:00
|
|
|
* 97/11/30
|
|
|
|
* 1.99.17 - No more bogus transparency indices in animated GIFs,
|
|
|
|
* hopefully. Saved files are better-behaved, sometimes
|
|
|
|
* smaller. [Adam]
|
|
|
|
*
|
1997-11-24 22:05:25 +00:00
|
|
|
* 97/09/29
|
|
|
|
* 1.99.16 - Added a dialog for the user to choose what to do if
|
|
|
|
* one of the layers of the image extends beyond the image
|
|
|
|
* borders - crop or cancel. Added code behind it.
|
|
|
|
*
|
|
|
|
* Corrected the number of bits for the base image to be
|
|
|
|
* on the generous side. Hopefully we can no longer generate
|
|
|
|
* GIFs which make XV barf.
|
|
|
|
*
|
|
|
|
* Now a lot more careful about whether we choose to encode
|
|
|
|
* as a GIF87a or a GIF89a. Hopefully does everything by the
|
|
|
|
* book. It should now be nigh-on impossible to torture the
|
|
|
|
* plugin into generating a GIF which isn't extremely well
|
|
|
|
* behaved with respect to the GIF89a specification.
|
|
|
|
*
|
|
|
|
* Fixed(?) a lot of dialog callback details, should now be
|
|
|
|
* happy with window deletion (GTK+970925). Fixed the
|
|
|
|
* cancellation of a save. [Adam]
|
|
|
|
*
|
|
|
|
* 97/09/16
|
|
|
|
* 1.99.15 - Hey! We can now cope with loading images which change
|
|
|
|
* colourmap between frames. This plugin will never save
|
|
|
|
* such abominations of nature while I still live, though.
|
|
|
|
* There should be no noncorrupt GIF in the universe which
|
|
|
|
* GIMP can't load and play now. [Adam]
|
|
|
|
*
|
|
|
|
* 97/09/14
|
|
|
|
* 1.99.14 - Added a check for layers whose extents don't lay
|
|
|
|
* within the image boundaries, which would make it a
|
|
|
|
* lot harder to generate badly-behaved GIFs. Doesn't
|
|
|
|
* do anything about it yet, but it should crop all layers
|
|
|
|
* to the image boundaries. Also, there's now a (separate)
|
|
|
|
* animation-preview plugin! [Adam]
|
|
|
|
*
|
|
|
|
* 97/08/29
|
|
|
|
* 1.99.13 - Basic ability to embed GIF comments within saved images.
|
|
|
|
* Fixed a bug with encoding the number of loops in a GIF file -
|
|
|
|
* would have been important, but we're not using that feature
|
|
|
|
* yet anyway. ;)
|
|
|
|
* Subtly improved dialog layout a little. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/25
|
|
|
|
* 1.99.12 - Fixed attempts to load GIFs which don't exist. Made a
|
|
|
|
* related cosmetic adjustment. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/10
|
|
|
|
* 1.99.11 - Fixed a bug with loading and saving GIFs where the bottom
|
|
|
|
* layer wasn't the same size as the image. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/06
|
|
|
|
* 1.99.10 - New 'save' dialog, now most of the default behaviour of
|
|
|
|
* animated GIF saving is user-settable (looping, default
|
|
|
|
* time between frames, etc.)
|
|
|
|
* PDB entry for saving is no longer compatible. Fortunately
|
|
|
|
* I don't think that anyone is using file_gif_save in
|
|
|
|
* scripts. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/05
|
|
|
|
* 1.99.9 - More animated GIF work: now loads and saves frame disposal
|
|
|
|
* information. This is neat and will also allow some delta
|
|
|
|
* stuff in the future.
|
|
|
|
* The disposal-method is kept in the layer name, like the timing
|
|
|
|
* info.
|
|
|
|
* (replace) - this frame replaces whatever else has been shown
|
|
|
|
* so far.
|
|
|
|
* (combine) - this frame builds apon the previous frame.
|
|
|
|
* If a disposal method is not specified, it is assumed to mean
|
|
|
|
* "don't care." [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/04
|
|
|
|
* 1.99.8 - Can save per-frame timing information too, now. The time
|
|
|
|
* for which a frame is visible is specified within the layer name
|
|
|
|
* as i,e. (250ms). If a frame doesn't have this timing value
|
|
|
|
* it defaults to lasting 100ms. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/02
|
|
|
|
* 1.99.7 - For animated GIFs, fixed the saving of timing information for
|
|
|
|
* frames which couldn't be made transparent.
|
|
|
|
* Added the loading of timing information into the layer
|
|
|
|
* names. Adjusted GIMP's GIF magic number very slightly. [Adam]
|
|
|
|
*
|
|
|
|
* 97/06/30
|
|
|
|
* 1.99.6 - Now saves GRAY and GRAYA images, albeit not always
|
|
|
|
* optimally (yet). [Adam]
|
|
|
|
*
|
|
|
|
* 97/06/25
|
|
|
|
* 1.99.5 - Good, the transparancy-on-big-architectures bug is
|
|
|
|
* fixed. Cleaned up some stuff.
|
|
|
|
* (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/06/23
|
|
|
|
* 1.99.4 - Trying to fix some endianness/word-size problems with
|
|
|
|
* transparent gif-saving on some architectures... does
|
|
|
|
* this help? (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/05/18
|
|
|
|
* 1.99.3 - Fixed the problem with GIFs getting loop extensions even
|
|
|
|
* if they only had one frame (thanks to Zach for noticing -
|
|
|
|
* git! :) ) (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/05/17
|
|
|
|
* 1.99.2 - Can now save animated GIFs. Correctly handles saving of
|
|
|
|
* image offsets. Uses N*tscape extentions to loop infinitely.
|
|
|
|
* Some notable shortcomings - see TODO list below.
|
|
|
|
* (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/05/16
|
|
|
|
* 1.99.1 - Implemented image offsets in animated GIF loading. Requires
|
|
|
|
* a fix to gimp_layer_translate in libgimp/gimplayer.c if used
|
|
|
|
* with GIMP versions <= 0.99.10. Started work on saving animated
|
|
|
|
* GIFs. Started TODO list. (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/05/15
|
|
|
|
* 1.99.0 - Started revision log. GIF plugin now loads/saves INDEXED
|
|
|
|
* and INDEXEDA images with correct transparency where possible.
|
|
|
|
* Loads multi-image (animated) GIFs as a framestack implemented
|
|
|
|
* in GIMP layers. Some bug fixes to original code, some new bugs
|
|
|
|
* cheerfully added. (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* Previous versions - load/save INDEXED images.
|
|
|
|
* (Peter Mattis & Spencer Kimball, gimp@scam.xcf.berkeley.edu)
|
|
|
|
*/
|
|
|
|
|
|
|
|
/*
|
|
|
|
* TODO (more *'s means more important!)
|
|
|
|
*
|
|
|
|
* - PDB stuff for comments
|
|
|
|
*
|
|
|
|
* - 'requantize' option for INDEXEDA images which really have 256 colours
|
|
|
|
* in them
|
|
|
|
*
|
|
|
|
* - Be a bit smarter about finding unused/superfluous colour indices for
|
|
|
|
* lossless colour crunching of INDEXEDA images. (Specifically, look
|
|
|
|
* for multiple indices which correspond to the same physical colour.)
|
|
|
|
*
|
|
|
|
* - Tidy up parameters for the GIFEncode routines
|
|
|
|
*
|
|
|
|
* - Remove unused colourmap entries for GRAYSCALE images.
|
|
|
|
*
|
1998-09-15 20:34:30 +00:00
|
|
|
* - Button to activate the animation preview plugin from the GIF-save
|
|
|
|
* dialog.
|
1997-11-24 22:05:25 +00:00
|
|
|
*
|
|
|
|
*/
|
|
|
|
|
1999-05-29 16:35:47 +00:00
|
|
|
#include "config.h"
|
2000-01-06 22:26:10 +00:00
|
|
|
|
2003-06-13 14:37:00 +00:00
|
|
|
#include <errno.h>
|
1997-11-24 22:05:25 +00:00
|
|
|
#include <string.h>
|
2000-01-06 22:26:10 +00:00
|
|
|
|
2005-03-04 15:12:29 +00:00
|
|
|
#include <glib/gstdio.h>
|
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
#include <libgimp/gimp.h>
|
|
|
|
#include <libgimp/gimpui.h>
|
2000-01-06 22:26:10 +00:00
|
|
|
|
1999-05-29 16:35:47 +00:00
|
|
|
#include "libgimp/stdplugins-intl.h"
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2000-04-30 21:03:44 +00:00
|
|
|
|
2005-08-13 22:52:41 +00:00
|
|
|
#define SAVE_PROC "file-gif-save"
|
|
|
|
#define PLUG_IN_BINARY "gif"
|
|
|
|
|
|
|
|
|
2003-07-29 06:52:41 +00:00
|
|
|
/* Define only one of these to determine which kind of gif's you would like.
|
|
|
|
* GIF_UN means use uncompressed gifs. These will be large, but no
|
|
|
|
* patent problems.
|
|
|
|
* GIF_RLE uses Run-length-encoding, which should not be covered by the
|
|
|
|
* patent, but this is not legal advice.
|
|
|
|
*/
|
|
|
|
/* #define GIF_UN */
|
|
|
|
/* #define GIF_RLE */
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
/* uncomment the line below for a little debugging info */
|
|
|
|
/* #define GIFDEBUG yesplease */
|
|
|
|
|
|
|
|
/* Does the version of GIMP we're compiling for support
|
|
|
|
data attachments to images? ('Parasites') */
|
|
|
|
#define FACEHUGGERS aieee
|
|
|
|
/* PS: I know that technically facehuggers aren't parasites,
|
1999-02-23 00:18:24 +00:00
|
|
|
the pupal-forms are. But facehuggers are ky00te. */
|
1998-10-09 18:01:35 +00:00
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
enum
|
|
|
|
{
|
|
|
|
DISPOSE_UNSPECIFIED,
|
|
|
|
DISPOSE_COMBINE,
|
|
|
|
DISPOSE_REPLACE
|
|
|
|
};
|
1998-10-09 18:01:35 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
typedef struct
|
|
|
|
{
|
2005-08-29 18:45:02 +00:00
|
|
|
gint interlace;
|
|
|
|
gint save_comment;
|
|
|
|
gint loop;
|
|
|
|
gint default_delay;
|
|
|
|
gint default_dispose;
|
|
|
|
gboolean always_use_default_delay;
|
|
|
|
gboolean always_use_default_dispose;
|
1997-11-24 22:05:25 +00:00
|
|
|
} GIFSaveVals;
|
|
|
|
|
|
|
|
|
|
|
|
/* Declare some local functions.
|
|
|
|
*/
|
1999-10-03 18:54:54 +00:00
|
|
|
static void query (void);
|
2003-07-02 11:07:41 +00:00
|
|
|
static void run (const gchar *name,
|
|
|
|
gint nparams,
|
|
|
|
const GimpParam *param,
|
|
|
|
gint *nreturn_vals,
|
|
|
|
GimpParam **return_vals);
|
|
|
|
static gint save_image (const gchar *filename,
|
|
|
|
gint32 image_ID,
|
|
|
|
gint32 drawable_ID,
|
|
|
|
gint32 orig_image_ID);
|
|
|
|
|
|
|
|
static gboolean boundscheck (gint32 image_ID);
|
1999-10-03 18:54:54 +00:00
|
|
|
static gboolean badbounds_dialog (void);
|
|
|
|
|
2004-05-19 15:28:01 +00:00
|
|
|
static gboolean save_dialog (gint32 image_ID);
|
|
|
|
static void comment_entry_callback (GtkTextBuffer *buffer);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
1999-04-25 16:10:43 +00:00
|
|
|
static gboolean comment_was_edited = FALSE;
|
|
|
|
|
2001-12-19 00:13:16 +00:00
|
|
|
static GimpRunMode run_mode;
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef FACEHUGGERS
|
2000-05-26 22:28:40 +00:00
|
|
|
GimpParasite * comment_parasite = NULL;
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
1998-03-16 10:05:41 +00:00
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
/* For compression code */
|
2000-01-25 17:46:56 +00:00
|
|
|
static gint Interlace;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
2000-08-22 01:26:57 +00:00
|
|
|
GimpPlugInInfo PLUG_IN_INFO =
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2000-01-25 17:46:56 +00:00
|
|
|
NULL, /* init_proc */
|
|
|
|
NULL, /* quit_proc */
|
|
|
|
query, /* query_proc */
|
|
|
|
run, /* run_proc */
|
1997-11-24 22:05:25 +00:00
|
|
|
};
|
|
|
|
|
|
|
|
static GIFSaveVals gsvals =
|
|
|
|
{
|
2000-06-07 22:51:23 +00:00
|
|
|
FALSE, /* interlace */
|
|
|
|
TRUE, /* save comment */
|
|
|
|
TRUE, /* loop infinitely */
|
1997-11-24 22:05:25 +00:00
|
|
|
100, /* default_delay between frames (100ms) */
|
2005-08-29 18:45:02 +00:00
|
|
|
0, /* default_dispose = "don't care" */
|
|
|
|
FALSE, /* don't always use default_delay */
|
|
|
|
FALSE /* don't always use default_dispose */
|
1997-11-24 22:05:25 +00:00
|
|
|
};
|
|
|
|
|
|
|
|
|
|
|
|
MAIN ()
|
|
|
|
|
|
|
|
static void
|
2000-01-25 17:46:56 +00:00
|
|
|
query (void)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
static GimpParamDef save_args[] =
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2005-08-13 22:52:41 +00:00
|
|
|
{ GIMP_PDB_INT32, "run-mode", "Interactive, non-interactive" },
|
2000-08-22 01:26:57 +00:00
|
|
|
{ GIMP_PDB_IMAGE, "image", "Image to save" },
|
|
|
|
{ GIMP_PDB_DRAWABLE, "drawable", "Drawable to save" },
|
|
|
|
{ GIMP_PDB_STRING, "filename", "The name of the file to save the image in" },
|
2005-08-13 22:52:41 +00:00
|
|
|
{ GIMP_PDB_STRING, "raw-filename", "The name entered" },
|
2000-08-22 01:26:57 +00:00
|
|
|
{ GIMP_PDB_INT32, "interlace", "Try to save as interlaced" },
|
|
|
|
{ GIMP_PDB_INT32, "loop", "(animated gif) loop infinitely" },
|
2005-08-13 22:52:41 +00:00
|
|
|
{ GIMP_PDB_INT32, "default-delay", "(animated gif) Default delay between framese in milliseconds" },
|
|
|
|
{ GIMP_PDB_INT32, "default-dispose", "(animated gif) Default disposal type (0=`don't care`, 1=combine, 2=replace)" }
|
1997-11-24 22:05:25 +00:00
|
|
|
};
|
|
|
|
|
2005-08-13 22:52:41 +00:00
|
|
|
gimp_install_procedure (SAVE_PROC,
|
2000-01-31 02:32:30 +00:00
|
|
|
"saves files in Compuserve GIF file format",
|
2000-10-20 03:38:15 +00:00
|
|
|
"Save a file in Compuserve GIF format, with "
|
|
|
|
"possible animation, transparency, and comment. "
|
|
|
|
"To save an animation, operate on a multi-layer "
|
|
|
|
"file. The plug-in will intrepret <50% alpha as "
|
|
|
|
"transparent. When run non-interactively, the "
|
|
|
|
"value for the comment is taken from the "
|
|
|
|
"'gimp-comment' parasite. ",
|
1997-11-24 22:05:25 +00:00
|
|
|
"Spencer Kimball, Peter Mattis, Adam Moss, David Koblas",
|
|
|
|
"Spencer Kimball, Peter Mattis, Adam Moss, David Koblas",
|
|
|
|
"1995-1997",
|
2004-05-14 00:01:11 +00:00
|
|
|
N_("GIF image"),
|
1999-10-03 18:54:54 +00:00
|
|
|
"INDEXED*, GRAY*",
|
2000-08-22 01:26:57 +00:00
|
|
|
GIMP_PLUGIN,
|
2001-12-06 02:28:58 +00:00
|
|
|
G_N_ELEMENTS (save_args), 0,
|
1997-11-24 22:05:25 +00:00
|
|
|
save_args, NULL);
|
|
|
|
|
2005-08-13 22:52:41 +00:00
|
|
|
gimp_register_file_handler_mime (SAVE_PROC, "image/gif");
|
|
|
|
gimp_register_save_handler (SAVE_PROC, "gif", "");
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
2003-07-02 11:07:41 +00:00
|
|
|
run (const gchar *name,
|
|
|
|
gint nparams,
|
|
|
|
const GimpParam *param,
|
|
|
|
gint *nreturn_vals,
|
|
|
|
GimpParam **return_vals)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2003-11-06 15:27:05 +00:00
|
|
|
static GimpParam values[2];
|
|
|
|
GimpPDBStatusType status = GIMP_PDB_SUCCESS;
|
|
|
|
gint32 image_ID;
|
|
|
|
gint32 drawable_ID;
|
|
|
|
gint32 orig_image_ID;
|
|
|
|
GimpExportReturn export = GIMP_EXPORT_CANCEL;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
run_mode = param[0].data.d_int32;
|
|
|
|
|
2003-03-25 16:38:19 +00:00
|
|
|
INIT_I18N ();
|
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
*nreturn_vals = 1;
|
|
|
|
*return_vals = values;
|
2000-08-22 01:26:57 +00:00
|
|
|
values[0].type = GIMP_PDB_STATUS;
|
|
|
|
values[0].data.d_status = GIMP_PDB_EXECUTION_ERROR;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2005-08-13 22:52:41 +00:00
|
|
|
if (strcmp (name, SAVE_PROC) == 0)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2000-01-25 17:46:56 +00:00
|
|
|
image_ID = orig_image_ID = param[1].data.d_int32;
|
|
|
|
drawable_ID = param[2].data.d_int32;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2003-11-06 15:27:05 +00:00
|
|
|
/* eventually export the image */
|
1999-10-03 18:54:54 +00:00
|
|
|
switch (run_mode)
|
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
case GIMP_RUN_INTERACTIVE:
|
|
|
|
case GIMP_RUN_WITH_LAST_VALS:
|
2005-08-13 22:52:41 +00:00
|
|
|
gimp_ui_init (PLUG_IN_BINARY, FALSE);
|
2003-11-06 15:27:05 +00:00
|
|
|
export = gimp_export_image (&image_ID, &drawable_ID, "GIF",
|
2000-08-24 14:17:34 +00:00
|
|
|
(GIMP_EXPORT_CAN_HANDLE_INDEXED |
|
2003-11-06 15:27:05 +00:00
|
|
|
GIMP_EXPORT_CAN_HANDLE_GRAY |
|
2000-08-24 14:17:34 +00:00
|
|
|
GIMP_EXPORT_CAN_HANDLE_ALPHA |
|
|
|
|
GIMP_EXPORT_CAN_HANDLE_LAYERS_AS_ANIMATION));
|
|
|
|
if (export == GIMP_EXPORT_CANCEL)
|
1999-10-03 23:48:33 +00:00
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
values[0].data.d_status = GIMP_PDB_CANCEL;
|
1999-10-03 23:48:33 +00:00
|
|
|
return;
|
|
|
|
}
|
1999-10-03 18:54:54 +00:00
|
|
|
break;
|
|
|
|
default:
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (boundscheck (image_ID))
|
1997-11-24 22:05:25 +00:00
|
|
|
/* The image may or may not have had layers out of
|
|
|
|
bounds, but the user didn't mind cropping it down. */
|
|
|
|
{
|
|
|
|
switch (run_mode)
|
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
case GIMP_RUN_INTERACTIVE:
|
2000-01-25 17:46:56 +00:00
|
|
|
/* Possibly retrieve data */
|
2005-08-13 22:52:41 +00:00
|
|
|
gimp_get_data (SAVE_PROC, &gsvals);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
/* First acquire information with a dialog */
|
|
|
|
if (! save_dialog (image_ID))
|
2000-08-22 01:26:57 +00:00
|
|
|
status = GIMP_PDB_CANCEL;
|
1997-11-24 22:05:25 +00:00
|
|
|
break;
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2000-08-22 01:26:57 +00:00
|
|
|
case GIMP_RUN_NONINTERACTIVE:
|
1997-11-24 22:05:25 +00:00
|
|
|
/* Make sure all the arguments are there! */
|
|
|
|
if (nparams != 9)
|
2000-01-25 17:46:56 +00:00
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
status = GIMP_PDB_CALLING_ERROR;
|
2000-01-25 17:46:56 +00:00
|
|
|
}
|
|
|
|
else
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2000-06-07 22:51:23 +00:00
|
|
|
gsvals.interlace = (param[5].data.d_int32) ? TRUE : FALSE;
|
|
|
|
gsvals.save_comment = TRUE; /* no way to to specify that through the PDB */
|
|
|
|
gsvals.loop = (param[6].data.d_int32) ? TRUE : FALSE;
|
2000-01-25 17:46:56 +00:00
|
|
|
gsvals.default_delay = param[7].data.d_int32;
|
1997-11-24 22:05:25 +00:00
|
|
|
gsvals.default_dispose = param[8].data.d_int32;
|
|
|
|
}
|
|
|
|
break;
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2000-08-22 01:26:57 +00:00
|
|
|
case GIMP_RUN_WITH_LAST_VALS:
|
1997-11-24 22:05:25 +00:00
|
|
|
/* Possibly retrieve data */
|
2005-08-13 22:52:41 +00:00
|
|
|
gimp_get_data (SAVE_PROC, &gsvals);
|
1997-11-24 22:05:25 +00:00
|
|
|
break;
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
default:
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
2000-08-22 01:26:57 +00:00
|
|
|
if (status == GIMP_PDB_SUCCESS)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2000-01-25 17:46:56 +00:00
|
|
|
if (save_image (param[3].data.d_string,
|
|
|
|
image_ID,
|
|
|
|
drawable_ID,
|
|
|
|
orig_image_ID))
|
|
|
|
{
|
|
|
|
/* Store psvals data */
|
2005-08-13 22:52:41 +00:00
|
|
|
gimp_set_data (SAVE_PROC, &gsvals, sizeof (GIFSaveVals));
|
2000-01-25 17:46:56 +00:00
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
status = GIMP_PDB_EXECUTION_ERROR;
|
2000-01-25 17:46:56 +00:00
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
else /* Some layers were out of bounds and the user wishes
|
|
|
|
to abort. */
|
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
status = GIMP_PDB_CANCEL;
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
1999-10-03 18:54:54 +00:00
|
|
|
|
2000-08-24 14:17:34 +00:00
|
|
|
if (export == GIMP_EXPORT_EXPORT)
|
1999-10-03 18:54:54 +00:00
|
|
|
gimp_image_delete (image_ID);
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
values[0].data.d_status = status;
|
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
#define MAXCOLORMAPSIZE 256
|
|
|
|
|
|
|
|
#define INTERLACE 0x40
|
|
|
|
#define LOCALCOLORMAP 0x80
|
|
|
|
|
|
|
|
#define GRAYSCALE 1
|
|
|
|
#define COLOR 2
|
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
typedef guchar CMap[3][MAXCOLORMAPSIZE];
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
2003-07-02 11:07:41 +00:00
|
|
|
static gchar * globalcomment = NULL;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/* ppmtogif.c - read a portable pixmap and produce a GIF file
|
|
|
|
**
|
1999-11-20 02:20:04 +00:00
|
|
|
** Based on GIFENCOD by David Rowley <mgardi@watdscu.waterloo.edu>. A
|
|
|
|
** Lempel-Ziv compression based on "compress".
|
1997-11-24 22:05:25 +00:00
|
|
|
**
|
|
|
|
** Modified by Marcel Wijkstra <wijkstra@fwi.uva.nl>
|
|
|
|
**
|
|
|
|
**
|
|
|
|
** Copyright (C) 1989 by Jef Poskanzer.
|
|
|
|
**
|
|
|
|
** Permission to use, copy, modify, and distribute this software and its
|
|
|
|
** documentation for any purpose and without fee is hereby granted, provided
|
|
|
|
** that the above copyright notice appear in all copies and that both that
|
|
|
|
** copyright notice and this permission notice appear in supporting
|
|
|
|
** documentation. This software is provided "as is" without express or
|
|
|
|
** implied warranty.
|
|
|
|
**
|
|
|
|
** The Graphics Interchange Format(c) is the Copyright property of
|
|
|
|
** CompuServe Incorporated. GIF(sm) is a Service Mark property of
|
|
|
|
** CompuServe Incorporated.
|
|
|
|
*/
|
|
|
|
|
|
|
|
#define MAXCOLORS 256
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Pointer to function returning an int
|
|
|
|
*/
|
|
|
|
typedef int (*ifunptr) (int, int);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* a code_int must be able to hold 2**BITS values of type int, and also -1
|
|
|
|
*/
|
|
|
|
typedef int code_int;
|
|
|
|
|
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
typedef unsigned long int count_int;
|
|
|
|
typedef unsigned short int count_short;
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
typedef long int count_int;
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
|
|
|
|
|
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
static gint find_unused_ia_colour (guchar *pixels,
|
|
|
|
gint numpixels,
|
|
|
|
gint num_indices,
|
|
|
|
gint *colors);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
static void special_flatten_indexed_alpha (guchar *pixels,
|
|
|
|
gint *transparent,
|
|
|
|
gint *colors,
|
|
|
|
gint numpixels);
|
1997-11-24 22:05:25 +00:00
|
|
|
static int colorstobpp (int);
|
1998-09-15 20:34:30 +00:00
|
|
|
static int bpptocolors (int);
|
1997-11-24 22:05:25 +00:00
|
|
|
static int GetPixel (int, int);
|
|
|
|
static void BumpPixel (void);
|
|
|
|
static int GIFNextPixel (ifunptr);
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
static void GIFEncodeHeader (FILE *, gboolean, int, int, int, int,
|
1997-11-24 22:05:25 +00:00
|
|
|
int *, int *, int *, ifunptr);
|
2003-06-16 17:37:11 +00:00
|
|
|
static void GIFEncodeGraphicControlExt (FILE *, int, int, int, int,
|
|
|
|
int, int, int, ifunptr);
|
|
|
|
static void GIFEncodeImageData (FILE *, int, int, int, int,
|
|
|
|
ifunptr, gint, gint);
|
|
|
|
static void GIFEncodeClose (FILE *);
|
1998-10-09 18:01:35 +00:00
|
|
|
static void GIFEncodeLoopExt (FILE *, guint);
|
2003-07-03 17:45:12 +00:00
|
|
|
static void GIFEncodeCommentExt (FILE *, const gchar *comment);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
int rowstride;
|
|
|
|
guchar *pixels;
|
|
|
|
int cur_progress;
|
|
|
|
int max_progress;
|
|
|
|
|
|
|
|
static void Putword (int, FILE *);
|
|
|
|
static void compress (int, FILE *, ifunptr);
|
2003-07-29 06:52:41 +00:00
|
|
|
#ifdef GIF_UN
|
|
|
|
static void nocompress (int, FILE *, ifunptr);
|
|
|
|
#else
|
|
|
|
#ifdef GIF_RLE
|
|
|
|
static void rlecompress (int, FILE *, ifunptr);
|
|
|
|
#else
|
|
|
|
static void normalcompress (int, FILE *, ifunptr);
|
|
|
|
#endif
|
|
|
|
#endif
|
1997-11-24 22:05:25 +00:00
|
|
|
static void output (code_int);
|
|
|
|
static void cl_block (void);
|
|
|
|
static void cl_hash (count_int);
|
|
|
|
static void writeerr (void);
|
|
|
|
static void char_init (void);
|
|
|
|
static void char_out (int);
|
|
|
|
static void flush_char (void);
|
|
|
|
|
|
|
|
|
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
static gint
|
|
|
|
find_unused_ia_colour (guchar *pixels,
|
|
|
|
gint numpixels,
|
|
|
|
gint num_indices,
|
|
|
|
gint *colors)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
int i;
|
|
|
|
gboolean ix_used[256];
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef GIFDEBUG
|
2003-06-16 17:51:03 +00:00
|
|
|
g_printerr ("GIF: fuiac: Image claims to use %d/%d indices - finding free "
|
|
|
|
"index...\n", (int)(*colors),(int)num_indices);
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
for (i=0; i<256; i++)
|
|
|
|
{
|
|
|
|
ix_used[i] = (gboolean)FALSE;
|
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
for (i=0; i<numpixels; i++)
|
|
|
|
{
|
2003-06-16 17:51:03 +00:00
|
|
|
if (pixels[i*2+1]) ix_used[pixels[i*2]] = (gboolean) TRUE;
|
1998-09-15 20:34:30 +00:00
|
|
|
}
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
for (i=num_indices-1; i>=0; i--)
|
|
|
|
{
|
|
|
|
if (ix_used[i] == (gboolean)FALSE)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef GIFDEBUG
|
2003-06-16 17:51:03 +00:00
|
|
|
g_printerr ("GIF: Found unused colour index %d.\n", (int) i);
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
1998-09-15 20:34:30 +00:00
|
|
|
return i;
|
|
|
|
}
|
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
/* Couldn't find an unused colour index within the number of
|
|
|
|
bits per pixel we wanted. Will have to increment the number
|
|
|
|
of colours in the image and assign a transparent pixel there. */
|
|
|
|
if ((*colors) < 256)
|
|
|
|
{
|
|
|
|
(*colors)++;
|
2003-06-16 17:51:03 +00:00
|
|
|
g_printerr ("GIF: 2nd pass "
|
|
|
|
"- Increasing bounds and using colour index %d.\n",
|
|
|
|
(int) (*colors)-1);
|
1998-09-15 20:34:30 +00:00
|
|
|
return ((*colors)-1);
|
|
|
|
}
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2003-11-15 13:53:33 +00:00
|
|
|
g_message (_("Couldn't simply reduce colors further. Saving as opaque."));
|
1997-11-24 22:05:25 +00:00
|
|
|
return (-1);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
static void
|
1997-11-24 22:05:25 +00:00
|
|
|
special_flatten_indexed_alpha (guchar *pixels,
|
|
|
|
int *transparent,
|
|
|
|
int *colors,
|
|
|
|
int numpixels)
|
|
|
|
{
|
|
|
|
guint32 i;
|
|
|
|
|
|
|
|
/* Each transparent pixel in the image is mapped to a uniform value for
|
|
|
|
encoding, if image already has <=255 colours */
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
if ((*transparent) == -1) /* tough, no indices left for the trans. index */
|
|
|
|
{
|
|
|
|
for (i=0; i<numpixels; i++)
|
|
|
|
pixels[i] = pixels[i*2];
|
|
|
|
}
|
|
|
|
else /* make transparent */
|
|
|
|
{
|
|
|
|
for (i=0; i<numpixels; i++)
|
|
|
|
{
|
|
|
|
if (!(pixels[i*2+1] & 128))
|
|
|
|
{
|
|
|
|
pixels[i] = (guchar)(*transparent);
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
pixels[i] = pixels[i*2];
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/* Pixel data now takes half as much space (the alpha data has been
|
|
|
|
discarded) */
|
1998-09-15 20:34:30 +00:00
|
|
|
/* pixels = g_realloc (pixels, numpixels);*/
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
static int
|
1997-11-24 22:05:25 +00:00
|
|
|
parse_ms_tag (char *str)
|
|
|
|
{
|
|
|
|
gint sum = 0;
|
|
|
|
gint offset = 0;
|
|
|
|
gint length;
|
|
|
|
|
|
|
|
length = strlen(str);
|
|
|
|
|
1998-04-29 10:48:02 +00:00
|
|
|
find_another_bra:
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
while ((offset<length) && (str[offset]!='('))
|
|
|
|
offset++;
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
if (offset>=length)
|
|
|
|
return(-1);
|
|
|
|
|
2003-11-26 19:20:24 +00:00
|
|
|
if (!g_ascii_isdigit (str[++offset]))
|
1998-04-29 10:48:02 +00:00
|
|
|
goto find_another_bra;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
do
|
|
|
|
{
|
|
|
|
sum *= 10;
|
|
|
|
sum += str[offset] - '0';
|
|
|
|
offset++;
|
|
|
|
}
|
2003-11-26 19:20:24 +00:00
|
|
|
while ((offset<length) && (g_ascii_isdigit (str[offset])));
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
if (length-offset <= 2)
|
|
|
|
return(-3);
|
|
|
|
|
2003-11-26 19:20:24 +00:00
|
|
|
if ((g_ascii_toupper (str[offset]) != 'M') ||
|
|
|
|
(g_ascii_toupper (str[offset+1]) != 'S'))
|
|
|
|
return -4;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2003-11-26 19:20:24 +00:00
|
|
|
return sum;
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
static int
|
1997-11-24 22:05:25 +00:00
|
|
|
parse_disposal_tag (char *str)
|
|
|
|
{
|
|
|
|
gint offset = 0;
|
|
|
|
gint length;
|
|
|
|
|
|
|
|
length = strlen(str);
|
|
|
|
|
|
|
|
while ((offset+9)<=length)
|
|
|
|
{
|
2003-11-06 15:27:05 +00:00
|
|
|
if (strncmp(&str[offset],"(combine)",9)==0)
|
1997-11-24 22:05:25 +00:00
|
|
|
return(0x01);
|
2003-11-06 15:27:05 +00:00
|
|
|
if (strncmp(&str[offset],"(replace)",9)==0)
|
1997-11-24 22:05:25 +00:00
|
|
|
return(0x02);
|
|
|
|
offset++;
|
|
|
|
}
|
|
|
|
|
|
|
|
return (gsvals.default_dispose);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static gboolean
|
|
|
|
boundscheck (gint32 image_ID)
|
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
GimpDrawable *drawable;
|
2001-07-07 14:53:42 +00:00
|
|
|
gint32 *layers;
|
|
|
|
gint nlayers;
|
|
|
|
gint i;
|
|
|
|
gint offset_x, offset_y;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/* get a list of layers for this image_ID */
|
2003-11-06 15:27:05 +00:00
|
|
|
layers = gimp_image_get_layers (image_ID, &nlayers);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
/*** Iterate through the layers to make sure they're all ***/
|
|
|
|
/*** within the bounds of the image ***/
|
|
|
|
|
2001-07-07 14:53:42 +00:00
|
|
|
for (i = 0; i < nlayers; i++)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
drawable = gimp_drawable_get (layers[i]);
|
|
|
|
gimp_drawable_offsets (layers[i], &offset_x, &offset_y);
|
|
|
|
|
|
|
|
if ((offset_x < 0) ||
|
|
|
|
(offset_y < 0) ||
|
|
|
|
(offset_x+drawable->width > gimp_image_width(image_ID)) ||
|
|
|
|
(offset_y+drawable->height > gimp_image_height(image_ID)))
|
|
|
|
{
|
|
|
|
g_free (layers);
|
|
|
|
gimp_drawable_detach(drawable);
|
|
|
|
|
|
|
|
/* Image has illegal bounds - ask the user what it wants to do */
|
|
|
|
|
2000-07-18 22:48:14 +00:00
|
|
|
/* Do the crop if we can't talk to the user, or if we asked
|
|
|
|
* the user and they said yes. */
|
2000-08-22 01:26:57 +00:00
|
|
|
if ((run_mode == GIMP_RUN_NONINTERACTIVE) || badbounds_dialog ())
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2001-07-07 14:53:42 +00:00
|
|
|
gimp_image_crop (image_ID,
|
|
|
|
gimp_image_width (image_ID),
|
2003-11-06 15:27:05 +00:00
|
|
|
gimp_image_height (image_ID),
|
2001-07-07 14:53:42 +00:00
|
|
|
0, 0);
|
1997-11-24 22:05:25 +00:00
|
|
|
return TRUE;
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
return FALSE;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
else
|
2001-07-07 14:53:42 +00:00
|
|
|
{
|
|
|
|
gimp_drawable_detach (drawable);
|
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
g_free (layers);
|
|
|
|
|
|
|
|
return TRUE;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static gint
|
2003-07-02 11:07:41 +00:00
|
|
|
save_image (const gchar *filename,
|
|
|
|
gint32 image_ID,
|
|
|
|
gint32 drawable_ID,
|
|
|
|
gint32 orig_image_ID)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
GimpPixelRgn pixel_rgn;
|
|
|
|
GimpDrawable *drawable;
|
|
|
|
GimpImageType drawable_type;
|
1997-11-24 22:05:25 +00:00
|
|
|
FILE *outfile;
|
2001-01-15 00:06:43 +00:00
|
|
|
gint Red[MAXCOLORS];
|
|
|
|
gint Green[MAXCOLORS];
|
|
|
|
gint Blue[MAXCOLORS];
|
1997-11-24 22:05:25 +00:00
|
|
|
guchar *cmap;
|
|
|
|
guint rows, cols;
|
2001-01-15 00:06:43 +00:00
|
|
|
gint BitsPerPixel, liberalBPP=0, useBPP=0;
|
|
|
|
gint colors;
|
|
|
|
gchar *temp_buf;
|
|
|
|
gint i;
|
|
|
|
gint transparent;
|
1997-11-24 22:05:25 +00:00
|
|
|
gint offset_x, offset_y;
|
|
|
|
|
2003-11-06 15:27:05 +00:00
|
|
|
gint32 *layers;
|
2001-01-15 00:06:43 +00:00
|
|
|
gint nlayers;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
gboolean is_gif89 = FALSE;
|
|
|
|
|
2001-01-15 00:06:43 +00:00
|
|
|
gint Delay89;
|
|
|
|
gint Disposal;
|
|
|
|
gchar *layer_name;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2001-01-15 00:06:43 +00:00
|
|
|
GimpRGB background;
|
|
|
|
guchar bgred, bggreen, bgblue;
|
2003-06-16 17:37:11 +00:00
|
|
|
guchar bgindex = 0;
|
|
|
|
guint best_error = 0xFFFFFFFF;
|
1998-03-16 10:05:41 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1999-04-25 16:10:43 +00:00
|
|
|
#ifdef FACEHUGGERS
|
|
|
|
/* Save the comment back to the ImageID, if appropriate */
|
1999-10-03 18:54:54 +00:00
|
|
|
if (globalcomment != NULL && comment_was_edited)
|
1999-04-25 16:10:43 +00:00
|
|
|
{
|
2000-05-26 22:28:40 +00:00
|
|
|
comment_parasite = gimp_parasite_new ("gimp-comment",
|
|
|
|
GIMP_PARASITE_PERSISTENT,
|
|
|
|
strlen (globalcomment)+1,
|
|
|
|
(void*) globalcomment);
|
1999-10-17 00:07:55 +00:00
|
|
|
gimp_image_parasite_attach (orig_image_ID, comment_parasite);
|
2000-05-26 22:28:40 +00:00
|
|
|
gimp_parasite_free (comment_parasite);
|
1999-04-25 16:10:43 +00:00
|
|
|
comment_parasite = NULL;
|
|
|
|
}
|
|
|
|
#endif
|
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
/* The GIF spec says 7bit ASCII for the comment block. */
|
|
|
|
if (gsvals.save_comment && globalcomment)
|
|
|
|
{
|
|
|
|
const gchar *c = globalcomment;
|
|
|
|
gint len;
|
|
|
|
|
|
|
|
for (len = strlen (c); len; c++, len--)
|
|
|
|
{
|
2003-12-05 23:40:09 +00:00
|
|
|
if ((guchar) *c > 127)
|
2003-07-03 17:45:12 +00:00
|
|
|
{
|
2003-11-15 13:53:33 +00:00
|
|
|
g_message (_("The GIF format only supports comments in "
|
2003-07-03 17:45:12 +00:00
|
|
|
"7bit ASCII encoding. No comment is saved."));
|
|
|
|
|
|
|
|
g_free (globalcomment);
|
|
|
|
globalcomment = NULL;
|
|
|
|
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/* get a list of layers for this image_ID */
|
2003-11-06 15:27:05 +00:00
|
|
|
layers = gimp_image_get_layers (image_ID, &nlayers);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
drawable_type = gimp_drawable_type (layers[0]);
|
|
|
|
|
|
|
|
|
|
|
|
/* If the image has multiple layers (i.e. will be animated), a comment,
|
|
|
|
or transparency, then it must be encoded as a GIF89a file, not a vanilla
|
|
|
|
GIF87a. */
|
1999-10-03 18:54:54 +00:00
|
|
|
if (nlayers > 1)
|
1997-11-24 22:05:25 +00:00
|
|
|
is_gif89 = TRUE;
|
2000-06-07 22:51:23 +00:00
|
|
|
|
|
|
|
if (gsvals.save_comment)
|
1997-11-24 22:05:25 +00:00
|
|
|
is_gif89 = TRUE;
|
|
|
|
|
|
|
|
switch (drawable_type)
|
|
|
|
{
|
2000-08-22 01:26:57 +00:00
|
|
|
case GIMP_INDEXEDA_IMAGE:
|
1997-11-24 22:05:25 +00:00
|
|
|
is_gif89 = TRUE;
|
2000-08-22 01:26:57 +00:00
|
|
|
case GIMP_INDEXED_IMAGE:
|
2004-11-02 12:00:25 +00:00
|
|
|
cmap = gimp_image_get_colormap (image_ID, &colors);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2004-09-22 18:43:09 +00:00
|
|
|
gimp_context_get_background (&background);
|
2001-01-15 00:06:43 +00:00
|
|
|
gimp_rgb_get_uchar (&background, &bgred, &bggreen, &bgblue);
|
1998-03-16 10:05:41 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
for (i = 0; i < colors; i++)
|
|
|
|
{
|
2001-01-15 00:06:43 +00:00
|
|
|
Red[i] = *cmap++;
|
1997-11-24 22:05:25 +00:00
|
|
|
Green[i] = *cmap++;
|
2001-01-15 00:06:43 +00:00
|
|
|
Blue[i] = *cmap++;
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
for ( ; i < 256; i++)
|
|
|
|
{
|
2001-01-15 00:06:43 +00:00
|
|
|
Red[i] = bgred;
|
1998-03-16 10:05:41 +00:00
|
|
|
Green[i] = bggreen;
|
2001-01-15 00:06:43 +00:00
|
|
|
Blue[i] = bgblue;
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
break;
|
2000-08-22 01:26:57 +00:00
|
|
|
case GIMP_GRAYA_IMAGE:
|
1997-11-24 22:05:25 +00:00
|
|
|
is_gif89 = TRUE;
|
2000-08-22 01:26:57 +00:00
|
|
|
case GIMP_GRAY_IMAGE:
|
1998-03-16 10:05:41 +00:00
|
|
|
colors = 256; /* FIXME: Not ideal. */
|
1997-11-24 22:05:25 +00:00
|
|
|
for ( i = 0; i < 256; i++)
|
|
|
|
{
|
|
|
|
Red[i] = Green[i] = Blue[i] = i;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
default:
|
2003-11-15 13:53:33 +00:00
|
|
|
g_message (_("Cannot save RGB color images. Convert to "
|
|
|
|
"indexed color or grayscale first."));
|
1997-11-24 22:05:25 +00:00
|
|
|
return FALSE;
|
|
|
|
}
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2003-06-16 17:37:11 +00:00
|
|
|
|
|
|
|
/* find earliest index in palette which is closest to the background
|
|
|
|
colour, and ATTEMPT to use that as the GIF's default background colour. */
|
|
|
|
for (i=255; i>=0; --i) {
|
|
|
|
unsigned int local_error = 0;
|
|
|
|
local_error += (Red[i] - bgred) * (Red[i] - bgred);
|
|
|
|
local_error += (Green[i] - bggreen) * (Green[i] - bggreen);
|
|
|
|
local_error += (Blue[i] - bgblue) * (Blue[i] - bgblue);
|
|
|
|
if (local_error <= best_error) {
|
|
|
|
bgindex = i;
|
|
|
|
best_error = local_error;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/* open the destination file for writing */
|
2005-03-04 15:12:29 +00:00
|
|
|
outfile = g_fopen (filename, "wb");
|
1997-11-24 22:05:25 +00:00
|
|
|
if (!outfile)
|
|
|
|
{
|
2003-11-15 13:53:33 +00:00
|
|
|
g_message (_("Could not open '%s' for writing: %s"),
|
2004-01-19 03:06:04 +00:00
|
|
|
gimp_filename_to_utf8 (filename), g_strerror (errno));
|
1997-11-24 22:05:25 +00:00
|
|
|
return FALSE;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
2003-11-06 15:27:05 +00:00
|
|
|
/* init the progress meter */
|
2004-01-19 11:13:35 +00:00
|
|
|
temp_buf = g_strdup_printf (_("Saving '%s'..."),
|
|
|
|
gimp_filename_to_utf8 (filename));
|
2003-06-13 14:37:00 +00:00
|
|
|
gimp_progress_init (temp_buf);
|
|
|
|
g_free (temp_buf);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2003-06-13 14:37:00 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
/* write the GIFheader */
|
|
|
|
|
|
|
|
if (colors < 256)
|
1998-03-16 10:05:41 +00:00
|
|
|
{
|
1998-09-15 20:34:30 +00:00
|
|
|
/* we keep track of how many bits we promised to have in liberalBPP,
|
|
|
|
so that we don't accidentally come under this when doing
|
|
|
|
clever transparency stuff where we can re-use wasted indices. */
|
|
|
|
liberalBPP = BitsPerPixel =
|
2000-08-22 01:26:57 +00:00
|
|
|
colorstobpp (colors + ((drawable_type==GIMP_INDEXEDA_IMAGE) ? 1 : 0));
|
1998-03-16 10:05:41 +00:00
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
else
|
1998-03-16 10:05:41 +00:00
|
|
|
{
|
1998-09-28 17:14:29 +00:00
|
|
|
liberalBPP = BitsPerPixel =
|
|
|
|
colorstobpp (256);
|
|
|
|
|
2000-08-22 01:26:57 +00:00
|
|
|
if (drawable_type==GIMP_INDEXEDA_IMAGE)
|
1998-09-15 20:34:30 +00:00
|
|
|
{
|
2003-06-16 17:51:03 +00:00
|
|
|
g_printerr ("GIF: Too many colours?\n");
|
1998-09-15 20:34:30 +00:00
|
|
|
}
|
1998-03-16 10:05:41 +00:00
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1999-10-03 18:54:54 +00:00
|
|
|
cols = gimp_image_width (image_ID);
|
|
|
|
rows = gimp_image_height (image_ID);
|
1998-10-09 18:01:35 +00:00
|
|
|
Interlace = gsvals.interlace;
|
2003-06-16 17:37:11 +00:00
|
|
|
GIFEncodeHeader (outfile, is_gif89, cols, rows, bgindex,
|
1998-10-09 18:01:35 +00:00
|
|
|
BitsPerPixel, Red, Green, Blue, GetPixel);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
/* If the image has multiple layers it'll be made into an
|
|
|
|
animated GIF, so write out the infinite-looping extension */
|
|
|
|
if ((nlayers > 1) && (gsvals.loop))
|
1998-10-09 18:01:35 +00:00
|
|
|
GIFEncodeLoopExt (outfile, 0);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/* Write comment extension - mustn't be written before the looping ext. */
|
2001-09-17 18:11:15 +00:00
|
|
|
if (gsvals.save_comment && globalcomment)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
GIFEncodeCommentExt (outfile, globalcomment);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/*** Now for each layer in the image, save an image in a compound GIF ***/
|
|
|
|
/************************************************************************/
|
|
|
|
|
|
|
|
i = nlayers-1;
|
|
|
|
|
|
|
|
while (i >= 0)
|
|
|
|
{
|
|
|
|
drawable_type = gimp_drawable_type (layers[i]);
|
|
|
|
drawable = gimp_drawable_get (layers[i]);
|
|
|
|
gimp_drawable_offsets (layers[i], &offset_x, &offset_y);
|
|
|
|
cols = drawable->width;
|
|
|
|
rows = drawable->height;
|
|
|
|
rowstride = drawable->width;
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1998-03-16 10:05:41 +00:00
|
|
|
gimp_pixel_rgn_init (&pixel_rgn, drawable, 0, 0,
|
|
|
|
drawable->width, drawable->height, FALSE, FALSE);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
cur_progress = 0;
|
|
|
|
max_progress = drawable->height;
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
pixels = (guchar *) g_malloc (drawable->width *
|
|
|
|
drawable->height *
|
2000-08-22 01:26:57 +00:00
|
|
|
(((drawable_type == GIMP_INDEXEDA_IMAGE)||
|
|
|
|
(drawable_type == GIMP_GRAYA_IMAGE)) ? 2:1) );
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1998-03-16 10:05:41 +00:00
|
|
|
gimp_pixel_rgn_get_rect (&pixel_rgn, pixels, 0, 0,
|
|
|
|
drawable->width, drawable->height);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
/* sort out whether we need to do transparency jiggery-pokery */
|
2000-08-22 01:26:57 +00:00
|
|
|
if ((drawable_type == GIMP_INDEXEDA_IMAGE)||(drawable_type == GIMP_GRAYA_IMAGE))
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
1997-12-08 00:22:45 +00:00
|
|
|
/* Try to find an entry which isn't actually used in the
|
|
|
|
image, for a transparency index. */
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-12-08 00:22:45 +00:00
|
|
|
transparent =
|
|
|
|
find_unused_ia_colour(pixels,
|
1998-09-15 20:34:30 +00:00
|
|
|
drawable->width * drawable->height,
|
|
|
|
bpptocolors(colorstobpp(colors)),
|
|
|
|
&colors);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
special_flatten_indexed_alpha (pixels,
|
|
|
|
&transparent,
|
|
|
|
&colors,
|
|
|
|
drawable->width * drawable->height);
|
|
|
|
}
|
|
|
|
else
|
|
|
|
transparent = -1;
|
2003-11-06 15:27:05 +00:00
|
|
|
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
BitsPerPixel = colorstobpp (colors);
|
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
if (BitsPerPixel != liberalBPP)
|
|
|
|
{
|
|
|
|
/* We were able to re-use an index within the existing bitspace,
|
|
|
|
whereas the estimate in the header was pessimistic but still
|
|
|
|
needs to be upheld... */
|
2003-06-16 17:37:11 +00:00
|
|
|
static gboolean onceonly = FALSE;
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2003-06-16 17:37:11 +00:00
|
|
|
if (!onceonly)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef GIFDEBUG
|
2003-06-16 17:51:03 +00:00
|
|
|
g_warning ("Promised %d bpp, pondered writing chunk with %d bpp!",
|
|
|
|
liberalBPP, BitsPerPixel);
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
2003-06-16 17:51:03 +00:00
|
|
|
g_message (_("Warning:\n"
|
|
|
|
"Transparent color in written file might be "
|
|
|
|
"incorrect on viewers which don't support "
|
|
|
|
"transparency."));
|
|
|
|
onceonly = TRUE;
|
2003-06-16 17:37:11 +00:00
|
|
|
}
|
1998-09-15 20:34:30 +00:00
|
|
|
}
|
|
|
|
useBPP = (BitsPerPixel > liberalBPP) ? BitsPerPixel : liberalBPP;
|
|
|
|
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
if (is_gif89)
|
|
|
|
{
|
2005-08-29 18:45:02 +00:00
|
|
|
if (i > 0 && !gsvals.always_use_default_dispose)
|
1997-12-12 10:01:21 +00:00
|
|
|
{
|
2003-12-03 16:39:32 +00:00
|
|
|
layer_name = gimp_drawable_get_name (layers[i - 1]);
|
|
|
|
Disposal = parse_disposal_tag (layer_name);
|
|
|
|
g_free (layer_name);
|
1997-12-12 10:01:21 +00:00
|
|
|
}
|
|
|
|
else
|
|
|
|
Disposal = gsvals.default_dispose;
|
|
|
|
|
2003-12-03 16:39:32 +00:00
|
|
|
layer_name = gimp_drawable_get_name (layers[i]);
|
|
|
|
Delay89 = parse_ms_tag (layer_name);
|
|
|
|
g_free (layer_name);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2005-08-29 18:45:02 +00:00
|
|
|
if (Delay89 < 0 || gsvals.always_use_default_delay)
|
1999-03-30 19:57:08 +00:00
|
|
|
Delay89 = (gsvals.default_delay + 5) / 10;
|
1997-11-24 22:05:25 +00:00
|
|
|
else
|
1999-03-30 19:57:08 +00:00
|
|
|
Delay89 = (Delay89 + 5) / 10;
|
|
|
|
|
|
|
|
/* don't allow a CPU-sucking completely 0-delay looping anim */
|
|
|
|
if ((nlayers > 1) &&
|
|
|
|
gsvals.loop &&
|
|
|
|
(Delay89 == 0))
|
|
|
|
{
|
|
|
|
static gboolean onceonly = FALSE;
|
|
|
|
|
|
|
|
if (!onceonly)
|
|
|
|
{
|
2003-06-16 17:51:03 +00:00
|
|
|
g_message (_("Delay inserted to prevent evil "
|
|
|
|
"CPU-sucking anim."));
|
1999-03-30 19:57:08 +00:00
|
|
|
onceonly = TRUE;
|
|
|
|
}
|
|
|
|
Delay89 = 1;
|
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
GIFEncodeGraphicControlExt (outfile, Disposal, Delay89, nlayers,
|
2003-06-16 17:37:11 +00:00
|
|
|
cols, rows,
|
1998-09-15 20:34:30 +00:00
|
|
|
transparent,
|
|
|
|
useBPP,
|
2003-06-16 17:37:11 +00:00
|
|
|
GetPixel);
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
GIFEncodeImageData (outfile, cols, rows,
|
|
|
|
(rows>4) ? gsvals.interlace : 0,
|
1998-09-15 20:34:30 +00:00
|
|
|
useBPP,
|
2003-06-16 17:37:11 +00:00
|
|
|
GetPixel,
|
1997-11-24 22:05:25 +00:00
|
|
|
offset_x, offset_y);
|
|
|
|
|
|
|
|
gimp_drawable_detach (drawable);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
g_free (pixels);
|
|
|
|
|
|
|
|
i--;
|
|
|
|
}
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
g_free(layers);
|
|
|
|
|
2003-06-16 17:37:11 +00:00
|
|
|
GIFEncodeClose (outfile);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
return TRUE;
|
|
|
|
}
|
|
|
|
|
|
|
|
static gboolean
|
2000-01-25 17:46:56 +00:00
|
|
|
badbounds_dialog (void)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
GtkWidget *dlg;
|
|
|
|
GtkWidget *label;
|
|
|
|
GtkWidget *vbox;
|
2003-11-06 15:27:05 +00:00
|
|
|
gboolean crop;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2000-01-06 22:26:10 +00:00
|
|
|
dlg = gimp_dialog_new (_("GIF Warning"), "gif_warning",
|
2003-11-06 15:27:05 +00:00
|
|
|
NULL, 0,
|
2004-01-20 17:10:16 +00:00
|
|
|
gimp_standard_help_func, "file-gif-save",
|
2000-01-06 22:26:10 +00:00
|
|
|
|
2003-11-06 15:27:05 +00:00
|
|
|
GTK_STOCK_CANCEL, GTK_RESPONSE_CANCEL,
|
|
|
|
GTK_STOCK_OK, GTK_RESPONSE_OK,
|
2000-01-06 22:26:10 +00:00
|
|
|
|
|
|
|
NULL);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2005-02-08 20:40:33 +00:00
|
|
|
gtk_dialog_set_alternative_button_order (GTK_DIALOG (dlg),
|
2005-08-13 22:52:41 +00:00
|
|
|
GTK_RESPONSE_OK,
|
|
|
|
GTK_RESPONSE_CANCEL,
|
|
|
|
-1);
|
2005-02-08 20:40:33 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
/* the warning message */
|
|
|
|
|
2004-05-19 15:28:01 +00:00
|
|
|
vbox = gtk_vbox_new (FALSE, 12);
|
|
|
|
gtk_container_set_border_width (GTK_CONTAINER (vbox), 12);
|
|
|
|
gtk_box_pack_start (GTK_BOX (GTK_DIALOG (dlg)->vbox), vbox, TRUE, TRUE, 0);
|
|
|
|
gtk_widget_show (vbox);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2000-01-06 22:26:10 +00:00
|
|
|
label= gtk_label_new (_("The image which you are trying to save as a GIF\n"
|
|
|
|
"contains layers which extend beyond the actual\n"
|
|
|
|
"borders of the image. This isn't allowed in GIFs,\n"
|
|
|
|
"I'm afraid.\n\n"
|
|
|
|
"You may choose whether to crop all of the layers to\n"
|
|
|
|
"the image borders, or cancel this save."));
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), label, TRUE, TRUE, 0);
|
2000-01-25 17:46:56 +00:00
|
|
|
gtk_widget_show (label);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
gtk_widget_show (dlg);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2003-11-11 18:11:56 +00:00
|
|
|
crop = (gimp_dialog_run (GIMP_DIALOG (dlg)) == GTK_RESPONSE_OK);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
|
|
|
gtk_widget_destroy (dlg);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2003-11-06 15:27:05 +00:00
|
|
|
return crop;
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static gint
|
2000-01-06 22:26:10 +00:00
|
|
|
save_dialog (gint32 image_ID)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2001-09-09 19:54:37 +00:00
|
|
|
GtkWidget *dlg;
|
|
|
|
GtkWidget *main_vbox;
|
|
|
|
GtkWidget *toggle;
|
|
|
|
GtkWidget *label;
|
|
|
|
GtkWidget *spinbutton;
|
|
|
|
GtkObject *adj;
|
|
|
|
GtkWidget *text_view;
|
2003-11-06 15:27:05 +00:00
|
|
|
GtkTextBuffer *text_buffer;
|
2001-09-09 19:54:37 +00:00
|
|
|
GtkWidget *frame;
|
|
|
|
GtkWidget *vbox;
|
|
|
|
GtkWidget *hbox;
|
2001-09-17 18:11:15 +00:00
|
|
|
GtkWidget *align;
|
2004-04-20 12:21:17 +00:00
|
|
|
GtkWidget *combo;
|
2001-09-09 19:54:37 +00:00
|
|
|
GtkWidget *scrolled_window;
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef FACEHUGGERS
|
2001-09-09 19:54:37 +00:00
|
|
|
GimpParasite *GIF2_CMNT;
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
2003-11-06 15:27:05 +00:00
|
|
|
gint32 nlayers;
|
|
|
|
gboolean run;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
gimp_image_get_layers (image_ID, &nlayers);
|
|
|
|
|
2005-08-13 22:52:41 +00:00
|
|
|
dlg = gimp_dialog_new (_("Save as GIF"), PLUG_IN_BINARY,
|
2003-11-06 15:27:05 +00:00
|
|
|
NULL, 0,
|
2005-08-13 22:52:41 +00:00
|
|
|
gimp_standard_help_func, SAVE_PROC,
|
2000-01-06 22:26:10 +00:00
|
|
|
|
2003-11-06 15:27:05 +00:00
|
|
|
GTK_STOCK_CANCEL, GTK_RESPONSE_CANCEL,
|
2005-09-02 11:09:03 +00:00
|
|
|
GTK_STOCK_SAVE, GTK_RESPONSE_OK,
|
2000-01-06 22:26:10 +00:00
|
|
|
|
|
|
|
NULL);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2005-08-13 22:52:41 +00:00
|
|
|
gtk_dialog_set_alternative_button_order (GTK_DIALOG (dlg),
|
|
|
|
GTK_RESPONSE_OK,
|
|
|
|
GTK_RESPONSE_CANCEL,
|
|
|
|
-1);
|
|
|
|
|
2004-05-19 15:28:01 +00:00
|
|
|
main_vbox = gtk_vbox_new (FALSE, 12);
|
|
|
|
gtk_container_set_border_width (GTK_CONTAINER (main_vbox), 12);
|
2000-01-25 17:46:56 +00:00
|
|
|
gtk_container_add (GTK_CONTAINER (GTK_DIALOG (dlg)->vbox), main_vbox);
|
|
|
|
gtk_widget_show (main_vbox);
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
/* regular gif parameter settings */
|
2004-05-19 15:28:01 +00:00
|
|
|
frame = gimp_frame_new (_("GIF Options"));
|
2000-01-25 17:46:56 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (main_vbox), frame, TRUE, TRUE, 0);
|
|
|
|
|
2004-05-19 15:28:01 +00:00
|
|
|
vbox = gtk_vbox_new (FALSE, 6);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_container_add (GTK_CONTAINER (frame), vbox);
|
|
|
|
|
2005-08-29 18:45:02 +00:00
|
|
|
toggle = gtk_check_button_new_with_mnemonic (_("I_nterlace"));
|
2000-01-25 17:46:56 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), toggle, FALSE, FALSE, 0);
|
1999-01-15 17:35:04 +00:00
|
|
|
gtk_toggle_button_set_active (GTK_TOGGLE_BUTTON (toggle), gsvals.interlace);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_widget_show (toggle);
|
|
|
|
|
2003-01-07 06:16:02 +00:00
|
|
|
g_signal_connect (toggle, "toggled",
|
2001-12-29 13:26:29 +00:00
|
|
|
G_CALLBACK (gimp_toggle_button_update),
|
|
|
|
&gsvals.interlace);
|
|
|
|
|
2004-05-19 15:28:01 +00:00
|
|
|
hbox = gtk_hbox_new (FALSE, 6);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), hbox, TRUE, TRUE, 0);
|
|
|
|
|
2001-09-17 18:11:15 +00:00
|
|
|
align = gtk_alignment_new (0.0, 0.0, 0, 0);
|
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), align, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_show (align);
|
|
|
|
|
2004-05-27 19:00:49 +00:00
|
|
|
toggle = gtk_check_button_new_with_mnemonic (_("_GIF comment:"));
|
2001-09-17 18:11:15 +00:00
|
|
|
gtk_container_add (GTK_CONTAINER (align), toggle);
|
2000-06-07 22:51:23 +00:00
|
|
|
gtk_toggle_button_set_active (GTK_TOGGLE_BUTTON (toggle), gsvals.save_comment);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_widget_show (toggle);
|
|
|
|
|
2003-01-07 06:16:02 +00:00
|
|
|
g_signal_connect (toggle, "toggled",
|
2001-12-29 13:26:29 +00:00
|
|
|
G_CALLBACK (gimp_toggle_button_update),
|
|
|
|
&gsvals.save_comment);
|
|
|
|
|
2001-09-09 19:54:37 +00:00
|
|
|
/* the comment text_view in a gtk_scrolled_window */
|
|
|
|
scrolled_window = gtk_scrolled_window_new (NULL, NULL);
|
2004-07-21 16:29:29 +00:00
|
|
|
gtk_scrolled_window_set_shadow_type (GTK_SCROLLED_WINDOW (scrolled_window),
|
|
|
|
GTK_SHADOW_IN);
|
2001-09-09 19:54:37 +00:00
|
|
|
gtk_scrolled_window_set_policy (GTK_SCROLLED_WINDOW (scrolled_window),
|
|
|
|
GTK_POLICY_AUTOMATIC,
|
|
|
|
GTK_POLICY_AUTOMATIC);
|
|
|
|
gtk_box_pack_start_defaults (GTK_BOX (hbox), scrolled_window);
|
|
|
|
gtk_widget_show (scrolled_window);
|
|
|
|
|
|
|
|
text_buffer = gtk_text_buffer_new (NULL);
|
|
|
|
|
|
|
|
text_view = gtk_text_view_new_with_buffer (text_buffer);
|
|
|
|
gtk_text_view_set_wrap_mode (GTK_TEXT_VIEW (text_view), GTK_WRAP_WORD);
|
|
|
|
gtk_container_add (GTK_CONTAINER (scrolled_window), text_view);
|
|
|
|
gtk_widget_show (text_view);
|
|
|
|
|
2003-01-07 06:16:02 +00:00
|
|
|
g_object_unref (text_buffer);
|
1999-01-23 18:49:52 +00:00
|
|
|
|
2004-11-23 14:28:43 +00:00
|
|
|
if (globalcomment)
|
|
|
|
g_free (globalcomment);
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef FACEHUGGERS
|
1999-10-17 00:07:55 +00:00
|
|
|
GIF2_CMNT = gimp_image_parasite_find (image_ID, "gimp-comment");
|
2000-01-25 17:46:56 +00:00
|
|
|
if (GIF2_CMNT)
|
2004-11-23 14:28:43 +00:00
|
|
|
globalcomment = g_strndup (gimp_parasite_data (GIF2_CMNT),
|
|
|
|
gimp_parasite_data_size (GIF2_CMNT));
|
2000-01-25 17:46:56 +00:00
|
|
|
else
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
2004-11-23 14:28:43 +00:00
|
|
|
globalcomment = gimp_get_default_comment ();
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef FACEHUGGERS
|
2000-05-26 22:28:40 +00:00
|
|
|
gimp_parasite_free (GIF2_CMNT);
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
1999-08-29 17:43:35 +00:00
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
if (globalcomment)
|
2001-09-09 19:54:37 +00:00
|
|
|
gtk_text_buffer_set_text (text_buffer, globalcomment, -1);
|
2001-12-29 13:26:29 +00:00
|
|
|
|
2003-01-07 06:16:02 +00:00
|
|
|
g_signal_connect (text_buffer, "changed",
|
2001-09-09 19:54:37 +00:00
|
|
|
G_CALLBACK (comment_entry_callback),
|
|
|
|
NULL);
|
2000-01-25 17:46:56 +00:00
|
|
|
|
|
|
|
gtk_widget_show (hbox);
|
|
|
|
|
|
|
|
gtk_widget_show (vbox);
|
|
|
|
gtk_widget_show (frame);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/* additional animated gif parameter settings */
|
2004-05-19 15:28:01 +00:00
|
|
|
frame = gimp_frame_new (_("Animated GIF Options"));
|
2000-01-25 17:46:56 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (main_vbox), frame, FALSE, FALSE, 0);
|
|
|
|
|
2004-05-19 15:28:01 +00:00
|
|
|
vbox = gtk_vbox_new (FALSE, 6);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_container_add (GTK_CONTAINER (frame), vbox);
|
|
|
|
|
2004-05-27 19:00:49 +00:00
|
|
|
toggle = gtk_check_button_new_with_mnemonic (_("_Loop forever"));
|
2000-01-25 17:46:56 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), toggle, FALSE, FALSE, 0);
|
1999-01-15 17:35:04 +00:00
|
|
|
gtk_toggle_button_set_active (GTK_TOGGLE_BUTTON (toggle), gsvals.loop);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_widget_show (toggle);
|
|
|
|
|
2003-01-07 06:16:02 +00:00
|
|
|
g_signal_connect (toggle, "toggled",
|
2001-12-29 13:26:29 +00:00
|
|
|
G_CALLBACK (gimp_toggle_button_update),
|
|
|
|
&gsvals.loop);
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
/* default_delay entry field */
|
2004-05-19 15:28:01 +00:00
|
|
|
hbox = gtk_hbox_new (FALSE, 6);
|
2000-01-25 17:46:56 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), hbox, FALSE, FALSE, 0);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2005-08-29 18:45:02 +00:00
|
|
|
label = gtk_label_new_with_mnemonic (_("_Delay between frames where unspecified:"));
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), label, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_show (label);
|
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
spinbutton = gimp_spin_button_new (&adj, gsvals.default_delay,
|
|
|
|
0, 65000, 10, 100, 0, 1, 0);
|
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), spinbutton, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_show (spinbutton);
|
|
|
|
|
2005-08-29 18:45:02 +00:00
|
|
|
gtk_label_set_mnemonic_widget (GTK_LABEL (label), spinbutton);
|
|
|
|
|
2005-06-30 16:03:24 +00:00
|
|
|
g_signal_connect (adj, "value-changed",
|
2001-12-29 13:26:29 +00:00
|
|
|
G_CALLBACK (gimp_int_adjustment_update),
|
|
|
|
&gsvals.default_delay);
|
|
|
|
|
2004-05-27 19:00:49 +00:00
|
|
|
label = gtk_label_new (_("milliseconds"));
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), label, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_show (label);
|
|
|
|
|
|
|
|
gtk_widget_show (hbox);
|
|
|
|
|
|
|
|
/* Disposal selector */
|
2004-05-19 15:28:01 +00:00
|
|
|
hbox = gtk_hbox_new (FALSE, 6);
|
2000-01-25 17:46:56 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), hbox, FALSE, FALSE, 0);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2005-08-29 18:45:02 +00:00
|
|
|
label = gtk_label_new_with_mnemonic (_("_Frame disposal where unspecified:"));
|
1998-10-09 18:01:35 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), label, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_show (label);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2004-05-27 19:00:49 +00:00
|
|
|
combo = gimp_int_combo_box_new (_("I don't care"),
|
2004-04-20 12:21:17 +00:00
|
|
|
DISPOSE_UNSPECIFIED,
|
2004-05-27 19:00:49 +00:00
|
|
|
_("Cumulative layers (combine)"),
|
2004-04-20 12:21:17 +00:00
|
|
|
DISPOSE_COMBINE,
|
2004-05-27 19:00:49 +00:00
|
|
|
_("One frame per layer (replace)"),
|
2004-04-20 12:21:17 +00:00
|
|
|
DISPOSE_REPLACE,
|
|
|
|
NULL);
|
|
|
|
gimp_int_combo_box_set_active (GIMP_INT_COMBO_BOX (combo),
|
|
|
|
gsvals.default_dispose);
|
2003-11-14 18:05:39 +00:00
|
|
|
|
2005-08-29 18:45:02 +00:00
|
|
|
gtk_label_set_mnemonic_widget (GTK_LABEL (label), combo);
|
|
|
|
|
2004-04-20 12:21:17 +00:00
|
|
|
g_signal_connect (combo, "changed",
|
|
|
|
G_CALLBACK (gimp_int_combo_box_get_active),
|
|
|
|
&gsvals.default_dispose);
|
2003-11-14 18:05:39 +00:00
|
|
|
|
2004-04-20 12:21:17 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), combo, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_show (combo);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2005-08-29 18:45:02 +00:00
|
|
|
/* The "Always use default values" toggles */
|
|
|
|
toggle = gtk_check_button_new_with_mnemonic (_("_Use delay entered above for all frames"));
|
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), toggle, FALSE, FALSE, 0);
|
|
|
|
gtk_toggle_button_set_active (GTK_TOGGLE_BUTTON (toggle),
|
|
|
|
gsvals.always_use_default_delay);
|
|
|
|
gtk_widget_show (toggle);
|
|
|
|
|
|
|
|
g_signal_connect (G_OBJECT (toggle), "toggled",
|
|
|
|
G_CALLBACK (gimp_toggle_button_update),
|
|
|
|
&gsvals.always_use_default_delay);
|
|
|
|
|
|
|
|
toggle = gtk_check_button_new_with_mnemonic (_("U_se disposal entered above for all frames"));
|
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), toggle, FALSE, FALSE, 0);
|
|
|
|
gtk_toggle_button_set_active (GTK_TOGGLE_BUTTON (toggle),
|
|
|
|
gsvals.always_use_default_dispose);
|
|
|
|
gtk_widget_show (toggle);
|
|
|
|
|
|
|
|
g_signal_connect (G_OBJECT (toggle), "toggled",
|
|
|
|
G_CALLBACK (gimp_toggle_button_update),
|
|
|
|
&gsvals.always_use_default_dispose);
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
gtk_widget_show (hbox);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_widget_show (vbox);
|
|
|
|
|
|
|
|
/* If the image has only one layer it can't be animated, so
|
|
|
|
desensitize the animation options. */
|
|
|
|
|
2004-04-20 12:21:17 +00:00
|
|
|
if (nlayers == 1)
|
|
|
|
gtk_widget_set_sensitive (frame, FALSE);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
gtk_widget_show (frame);
|
|
|
|
gtk_widget_show (dlg);
|
|
|
|
|
2003-11-11 18:11:56 +00:00
|
|
|
run = (gimp_dialog_run (GIMP_DIALOG (dlg)) == GTK_RESPONSE_OK);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
|
|
|
gtk_widget_destroy (dlg);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2003-11-06 15:27:05 +00:00
|
|
|
return run;
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static int
|
|
|
|
colorstobpp (int colors)
|
|
|
|
{
|
|
|
|
int bpp;
|
|
|
|
|
|
|
|
if (colors <= 2)
|
|
|
|
bpp = 1;
|
|
|
|
else if (colors <= 4)
|
|
|
|
bpp = 2;
|
|
|
|
else if (colors <= 8)
|
|
|
|
bpp = 3;
|
|
|
|
else if (colors <= 16)
|
|
|
|
bpp = 4;
|
|
|
|
else if (colors <= 32)
|
|
|
|
bpp = 5;
|
|
|
|
else if (colors <= 64)
|
|
|
|
bpp = 6;
|
|
|
|
else if (colors <= 128)
|
|
|
|
bpp = 7;
|
|
|
|
else if (colors <= 256)
|
|
|
|
bpp = 8;
|
|
|
|
else
|
|
|
|
{
|
1999-12-28 20:04:19 +00:00
|
|
|
g_warning ("GIF: colorstobpp - Eep! too many colours: %d\n", colors);
|
1997-11-24 22:05:25 +00:00
|
|
|
return 8;
|
|
|
|
}
|
|
|
|
|
|
|
|
return bpp;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
static int
|
|
|
|
bpptocolors (int bpp)
|
|
|
|
{
|
|
|
|
int colors;
|
|
|
|
|
|
|
|
if (bpp>8)
|
|
|
|
{
|
1999-12-28 20:04:19 +00:00
|
|
|
g_warning ("GIF: bpptocolors - Eep! bpp==%d !\n", bpp);
|
1998-09-15 20:34:30 +00:00
|
|
|
return 256;
|
|
|
|
}
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
colors = 1 << bpp;
|
|
|
|
|
|
|
|
return (colors);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
static int
|
|
|
|
GetPixel (int x,
|
|
|
|
int y)
|
|
|
|
{
|
|
|
|
return *(pixels + (rowstride * (long) y) + (long) x);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/*****************************************************************************
|
|
|
|
*
|
|
|
|
* GIFENCODE.C - GIF Image compression interface
|
|
|
|
*
|
|
|
|
* GIFEncode( FName, GHeight, GWidth, GInterlace, Background, Transparent,
|
|
|
|
* BitsPerPixel, Red, Green, Blue, GetPixel )
|
|
|
|
*
|
|
|
|
*****************************************************************************/
|
|
|
|
|
2000-01-25 17:46:56 +00:00
|
|
|
static gint Width, Height;
|
|
|
|
static gint curx, cury;
|
|
|
|
static glong CountDown;
|
|
|
|
static gint Pass = 0;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/*
|
|
|
|
* Bump the 'curx' and 'cury' to point to the next pixel
|
|
|
|
*/
|
|
|
|
static void
|
2000-01-25 17:46:56 +00:00
|
|
|
BumpPixel (void)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
/*
|
|
|
|
* Bump the current X position
|
|
|
|
*/
|
1998-10-09 18:01:35 +00:00
|
|
|
curx++;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/*
|
|
|
|
* If we are at the end of a scan line, set curx back to the beginning
|
|
|
|
* If we are interlaced, bump the cury to the appropriate spot,
|
|
|
|
* otherwise, just increment it.
|
|
|
|
*/
|
|
|
|
if (curx == Width)
|
|
|
|
{
|
2003-06-13 14:37:00 +00:00
|
|
|
cur_progress++;
|
|
|
|
if ((cur_progress % 16) == 0)
|
|
|
|
gimp_progress_update ((double) cur_progress / (double) max_progress);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
curx = 0;
|
|
|
|
|
|
|
|
if (!Interlace)
|
|
|
|
++cury;
|
|
|
|
else
|
|
|
|
{
|
|
|
|
switch (Pass)
|
|
|
|
{
|
|
|
|
|
|
|
|
case 0:
|
|
|
|
cury += 8;
|
|
|
|
if (cury >= Height)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
Pass++;
|
1997-11-24 22:05:25 +00:00
|
|
|
cury = 4;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
case 1:
|
|
|
|
cury += 8;
|
|
|
|
if (cury >= Height)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
Pass++;
|
1997-11-24 22:05:25 +00:00
|
|
|
cury = 2;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
case 2:
|
|
|
|
cury += 4;
|
|
|
|
if (cury >= Height)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
Pass++;
|
1997-11-24 22:05:25 +00:00
|
|
|
cury = 1;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
case 3:
|
|
|
|
cury += 2;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Return the next pixel from the image
|
|
|
|
*/
|
|
|
|
static int
|
|
|
|
GIFNextPixel (ifunptr getpixel)
|
|
|
|
{
|
|
|
|
int r;
|
|
|
|
|
|
|
|
if (CountDown == 0)
|
|
|
|
return EOF;
|
|
|
|
|
|
|
|
--CountDown;
|
|
|
|
|
|
|
|
r = (*getpixel) (curx, cury);
|
|
|
|
|
|
|
|
BumpPixel ();
|
|
|
|
|
|
|
|
return r;
|
|
|
|
}
|
|
|
|
|
|
|
|
/* public */
|
|
|
|
|
|
|
|
static void
|
|
|
|
GIFEncodeHeader (FILE *fp,
|
|
|
|
gboolean gif89,
|
|
|
|
int GWidth,
|
|
|
|
int GHeight,
|
|
|
|
int Background,
|
|
|
|
int BitsPerPixel,
|
|
|
|
int Red[],
|
|
|
|
int Green[],
|
|
|
|
int Blue[],
|
|
|
|
ifunptr GetPixel)
|
|
|
|
{
|
|
|
|
int B;
|
|
|
|
int RWidth, RHeight;
|
|
|
|
int LeftOfs, TopOfs;
|
|
|
|
int Resolution;
|
|
|
|
int ColorMapSize;
|
|
|
|
int InitCodeSize;
|
|
|
|
int i;
|
|
|
|
|
|
|
|
ColorMapSize = 1 << BitsPerPixel;
|
|
|
|
|
|
|
|
RWidth = Width = GWidth;
|
|
|
|
RHeight = Height = GHeight;
|
|
|
|
LeftOfs = TopOfs = 0;
|
|
|
|
|
|
|
|
Resolution = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Calculate number of bits we are expecting
|
|
|
|
*/
|
|
|
|
CountDown = (long) Width *(long) Height;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Indicate which pass we are on (if interlace)
|
|
|
|
*/
|
|
|
|
Pass = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* The initial code size
|
|
|
|
*/
|
|
|
|
if (BitsPerPixel <= 1)
|
|
|
|
InitCodeSize = 2;
|
|
|
|
else
|
|
|
|
InitCodeSize = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the current x and y position
|
|
|
|
*/
|
|
|
|
curx = cury = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write the Magic header
|
|
|
|
*/
|
|
|
|
fwrite (gif89 ? "GIF89a" : "GIF87a", 1, 6, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the screen width and height
|
|
|
|
*/
|
|
|
|
Putword (RWidth, fp);
|
|
|
|
Putword (RHeight, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Indicate that there is a global colour map
|
|
|
|
*/
|
|
|
|
B = 0x80; /* Yes, there is a color map */
|
|
|
|
|
|
|
|
/*
|
|
|
|
* OR in the resolution
|
|
|
|
*/
|
|
|
|
B |= (Resolution - 1) << 5;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* OR in the Bits per Pixel
|
|
|
|
*/
|
|
|
|
B |= (BitsPerPixel - 1);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write it out
|
|
|
|
*/
|
|
|
|
fputc (B, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the Background colour
|
|
|
|
*/
|
|
|
|
fputc (Background, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Byte of 0's (future expansion)
|
|
|
|
*/
|
|
|
|
fputc (0, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the Global Colour Map
|
|
|
|
*/
|
1998-10-09 18:01:35 +00:00
|
|
|
for (i = 0; i < ColorMapSize; i++)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
fputc (Red[i], fp);
|
|
|
|
fputc (Green[i], fp);
|
|
|
|
fputc (Blue[i], fp);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
GIFEncodeGraphicControlExt (FILE *fp,
|
|
|
|
int Disposal,
|
|
|
|
int Delay89,
|
|
|
|
int NumFramesInImage,
|
|
|
|
int GWidth,
|
|
|
|
int GHeight,
|
|
|
|
int Transparent,
|
|
|
|
int BitsPerPixel,
|
|
|
|
ifunptr GetPixel)
|
|
|
|
{
|
|
|
|
int RWidth, RHeight;
|
|
|
|
int LeftOfs, TopOfs;
|
|
|
|
int Resolution;
|
|
|
|
int ColorMapSize;
|
|
|
|
int InitCodeSize;
|
|
|
|
|
|
|
|
ColorMapSize = 1 << BitsPerPixel;
|
|
|
|
|
|
|
|
RWidth = Width = GWidth;
|
|
|
|
RHeight = Height = GHeight;
|
|
|
|
LeftOfs = TopOfs = 0;
|
|
|
|
|
|
|
|
Resolution = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Calculate number of bits we are expecting
|
|
|
|
*/
|
|
|
|
CountDown = (long) Width *(long) Height;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Indicate which pass we are on (if interlace)
|
|
|
|
*/
|
|
|
|
Pass = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* The initial code size
|
|
|
|
*/
|
|
|
|
if (BitsPerPixel <= 1)
|
|
|
|
InitCodeSize = 2;
|
|
|
|
else
|
|
|
|
InitCodeSize = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the current x and y position
|
|
|
|
*/
|
|
|
|
curx = cury = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out extension for transparent colour index, if necessary.
|
|
|
|
*/
|
|
|
|
if ( (Transparent >= 0) || (NumFramesInImage > 1) )
|
|
|
|
{
|
|
|
|
/* Extension Introducer - fixed. */
|
|
|
|
fputc ('!', fp);
|
|
|
|
/* Graphic Control Label - fixed. */
|
|
|
|
fputc (0xf9, fp);
|
|
|
|
/* Block Size - fixed. */
|
|
|
|
fputc (4, fp);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
/* Packed Fields - XXXdddut (d=disposal, u=userInput, t=transFlag) */
|
|
|
|
/* s8421 */
|
|
|
|
fputc ( ((Transparent >= 0) ? 0x01 : 0x00) /* TRANSPARENCY */
|
|
|
|
|
|
|
|
/* DISPOSAL */
|
|
|
|
| ((NumFramesInImage > 1) ? (Disposal << 2) : 0x00 ),
|
|
|
|
/* 0x03 or 0x01 build frames cumulatively */
|
|
|
|
/* 0x02 clears frame before drawing */
|
|
|
|
/* 0x00 'don't care' */
|
|
|
|
|
|
|
|
fp);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
fputc (Delay89 & 255, fp);
|
|
|
|
fputc ((Delay89>>8) & 255, fp);
|
|
|
|
|
|
|
|
fputc (Transparent, fp);
|
|
|
|
fputc (0, fp);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
GIFEncodeImageData (FILE *fp,
|
|
|
|
int GWidth,
|
|
|
|
int GHeight,
|
|
|
|
int GInterlace,
|
|
|
|
int BitsPerPixel,
|
|
|
|
ifunptr GetPixel,
|
|
|
|
gint offset_x,
|
|
|
|
gint offset_y)
|
|
|
|
{
|
|
|
|
int RWidth, RHeight;
|
|
|
|
int LeftOfs, TopOfs;
|
|
|
|
int Resolution;
|
|
|
|
int ColorMapSize;
|
|
|
|
int InitCodeSize;
|
|
|
|
|
|
|
|
Interlace = GInterlace;
|
|
|
|
|
|
|
|
ColorMapSize = 1 << BitsPerPixel;
|
|
|
|
|
|
|
|
RWidth = Width = GWidth;
|
|
|
|
RHeight = Height = GHeight;
|
|
|
|
LeftOfs = (int) offset_x;
|
|
|
|
TopOfs = (int) offset_y;
|
|
|
|
|
|
|
|
Resolution = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Calculate number of bits we are expecting
|
|
|
|
*/
|
|
|
|
CountDown = (long) Width *(long) Height;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Indicate which pass we are on (if interlace)
|
|
|
|
*/
|
|
|
|
Pass = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* The initial code size
|
|
|
|
*/
|
|
|
|
if (BitsPerPixel <= 1)
|
|
|
|
InitCodeSize = 2;
|
|
|
|
else
|
|
|
|
InitCodeSize = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the current x and y position
|
|
|
|
*/
|
|
|
|
curx = cury = 0;
|
|
|
|
|
|
|
|
#if 0
|
|
|
|
/*
|
|
|
|
* Write an Image separator
|
|
|
|
*/
|
|
|
|
fputc (',', fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write the Image header
|
|
|
|
*/
|
|
|
|
|
|
|
|
Putword (LeftOfs, fp);
|
|
|
|
Putword (TopOfs, fp);
|
|
|
|
Putword (Width, fp);
|
|
|
|
Putword (Height, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out whether or not the image is interlaced
|
|
|
|
*/
|
|
|
|
if (Interlace)
|
|
|
|
fputc (0x40, fp);
|
|
|
|
else
|
|
|
|
fputc (0x00, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the initial code size
|
|
|
|
*/
|
|
|
|
fputc (InitCodeSize, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Go and actually compress the data
|
|
|
|
*/
|
|
|
|
compress (InitCodeSize + 1, fp, GetPixel);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out a Zero-length packet (to end the series)
|
|
|
|
*/
|
|
|
|
fputc (0, fp);
|
|
|
|
|
|
|
|
|
|
|
|
/***************************/
|
|
|
|
Interlace = GInterlace;
|
|
|
|
ColorMapSize = 1 << BitsPerPixel;
|
|
|
|
RWidth = Width = GWidth;
|
|
|
|
RHeight = Height = GHeight;
|
|
|
|
LeftOfs = TopOfs = 0;
|
|
|
|
Resolution = BitsPerPixel;
|
|
|
|
|
|
|
|
CountDown = (long) Width *(long) Height;
|
|
|
|
Pass = 0;
|
|
|
|
/*
|
|
|
|
* The initial code size
|
|
|
|
*/
|
|
|
|
if (BitsPerPixel <= 1)
|
|
|
|
InitCodeSize = 2;
|
|
|
|
else
|
|
|
|
InitCodeSize = BitsPerPixel;
|
|
|
|
/*
|
|
|
|
* Set up the current x and y position
|
|
|
|
*/
|
|
|
|
curx = cury = 0;
|
|
|
|
|
|
|
|
#endif
|
|
|
|
|
|
|
|
|
|
|
|
cur_progress = 0;
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write an Image separator
|
|
|
|
*/
|
|
|
|
fputc (',', fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write the Image header
|
|
|
|
*/
|
|
|
|
|
|
|
|
Putword (LeftOfs, fp);
|
|
|
|
Putword (TopOfs, fp);
|
|
|
|
Putword (Width, fp);
|
|
|
|
Putword (Height, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out whether or not the image is interlaced
|
|
|
|
*/
|
|
|
|
if (Interlace)
|
|
|
|
fputc (0x40, fp);
|
|
|
|
else
|
|
|
|
fputc (0x00, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the initial code size
|
|
|
|
*/
|
|
|
|
fputc (InitCodeSize, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Go and actually compress the data
|
|
|
|
*/
|
|
|
|
compress (InitCodeSize + 1, fp, GetPixel);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out a Zero-length packet (to end the series)
|
|
|
|
*/
|
|
|
|
fputc (0, fp);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
2003-06-16 17:37:11 +00:00
|
|
|
GIFEncodeClose (FILE *fp)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
/*
|
|
|
|
* Write the GIF file terminator
|
|
|
|
*/
|
|
|
|
fputc (';', fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* And close the file
|
|
|
|
*/
|
|
|
|
fclose (fp);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
GIFEncodeLoopExt (FILE *fp,
|
|
|
|
guint num_loops)
|
|
|
|
{
|
|
|
|
fputc(0x21,fp);
|
|
|
|
fputc(0xff,fp);
|
|
|
|
fputc(0x0b,fp);
|
|
|
|
fputs("NETSCAPE2.0",fp);
|
|
|
|
fputc(0x03,fp);
|
|
|
|
fputc(0x01,fp);
|
|
|
|
Putword(num_loops,fp);
|
|
|
|
fputc(0x00,fp);
|
|
|
|
|
|
|
|
/* NOTE: num_loops==0 means 'loop infinitely' */
|
|
|
|
}
|
|
|
|
|
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
static void
|
|
|
|
GIFEncodeCommentExt (FILE *fp,
|
|
|
|
const gchar *comment)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
1999-11-20 02:20:04 +00:00
|
|
|
if (!comment || !*comment)
|
|
|
|
return;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
if (strlen (comment) > 240)
|
1999-01-23 18:49:52 +00:00
|
|
|
{
|
2003-06-16 17:51:03 +00:00
|
|
|
g_printerr ("GIF: warning:"
|
|
|
|
"comment too large - comment block not written.\n");
|
1999-01-23 18:49:52 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
2003-07-03 17:45:12 +00:00
|
|
|
fputc (0x21, fp);
|
|
|
|
fputc (0xfe, fp);
|
|
|
|
fputc (strlen (comment), fp);
|
|
|
|
fputs (comment, fp);
|
|
|
|
fputc (0x00, fp);
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out a word to the GIF file
|
|
|
|
*/
|
|
|
|
static void
|
|
|
|
Putword (int w,
|
|
|
|
FILE *fp)
|
|
|
|
{
|
|
|
|
fputc (w & 0xff, fp);
|
|
|
|
fputc ((w / 256) & 0xff, fp);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/***************************************************************************
|
|
|
|
*
|
|
|
|
* GIFCOMPR.C - GIF Image compression routines
|
|
|
|
*
|
|
|
|
* Lempel-Ziv compression based on 'compress'. GIF modifications by
|
|
|
|
* David Rowley (mgardi@watdcsu.waterloo.edu)
|
|
|
|
*
|
|
|
|
***************************************************************************/
|
|
|
|
|
|
|
|
/*
|
|
|
|
* General DEFINEs
|
|
|
|
*/
|
|
|
|
|
|
|
|
#define GIF_BITS 12
|
|
|
|
|
|
|
|
#define HSIZE 5003 /* 80% occupancy */
|
|
|
|
|
|
|
|
#ifdef NO_UCHAR
|
|
|
|
typedef char char_type;
|
|
|
|
#else /*NO_UCHAR */
|
|
|
|
typedef unsigned char char_type;
|
|
|
|
#endif /*NO_UCHAR */
|
|
|
|
|
|
|
|
/*
|
|
|
|
|
|
|
|
* GIF Image compression - modified 'compress'
|
|
|
|
*
|
|
|
|
* Based on: compress.c - File compression ala IEEE Computer, June 1984.
|
|
|
|
*
|
|
|
|
* By Authors: Spencer W. Thomas (decvax!harpo!utah-cs!utah-gr!thomas)
|
|
|
|
* Jim McKie (decvax!mcvax!jim)
|
|
|
|
* Steve Davies (decvax!vax135!petsd!peora!srd)
|
|
|
|
* Ken Turkowski (decvax!decwrl!turtlevax!ken)
|
|
|
|
* James A. Woods (decvax!ihnp4!ames!jaw)
|
|
|
|
* Joe Orost (decvax!vax135!petsd!joe)
|
|
|
|
*
|
|
|
|
*/
|
|
|
|
|
|
|
|
#define ARGVAL() (*++(*argv) || (--argc && *++argv))
|
|
|
|
|
|
|
|
static int n_bits; /* number of bits/code */
|
|
|
|
static int maxbits = GIF_BITS; /* user settable max # bits/code */
|
|
|
|
static code_int maxcode; /* maximum code, given n_bits */
|
|
|
|
static code_int maxmaxcode = (code_int) 1 << GIF_BITS; /* should NEVER generate this code */
|
|
|
|
#ifdef COMPATIBLE /* But wrong! */
|
|
|
|
#define MAXCODE(Mn_bits) ((code_int) 1 << (Mn_bits) - 1)
|
|
|
|
#else /*COMPATIBLE */
|
|
|
|
#define MAXCODE(Mn_bits) (((code_int) 1 << (Mn_bits)) - 1)
|
|
|
|
#endif /*COMPATIBLE */
|
|
|
|
|
|
|
|
static count_int htab[HSIZE];
|
|
|
|
static unsigned short codetab[HSIZE];
|
|
|
|
#define HashTabOf(i) htab[i]
|
|
|
|
#define CodeTabOf(i) codetab[i]
|
|
|
|
|
2004-07-21 17:06:18 +00:00
|
|
|
static const code_int hsize = HSIZE; /* the original reason for this being
|
1997-11-24 22:05:25 +00:00
|
|
|
variable was "for dynamic table sizing",
|
|
|
|
but since it was never actually changed
|
|
|
|
I made it const --Adam. */
|
|
|
|
|
|
|
|
/*
|
|
|
|
* To save much memory, we overlay the table used by compress() with those
|
|
|
|
* used by decompress(). The tab_prefix table is the same size and type
|
|
|
|
* as the codetab. The tab_suffix table needs 2**GIF_BITS characters. We
|
|
|
|
* get this from the beginning of htab. The output stack uses the rest
|
|
|
|
* of htab, and contains characters. There is plenty of room for any
|
|
|
|
* possible stack (stack used to be 8000 characters).
|
|
|
|
*/
|
|
|
|
|
|
|
|
#define tab_prefixof(i) CodeTabOf(i)
|
|
|
|
#define tab_suffixof(i) ((char_type*)(htab))[i]
|
|
|
|
#define de_stack ((char_type*)&tab_suffixof((code_int)1<<GIF_BITS))
|
|
|
|
|
|
|
|
static code_int free_ent = 0; /* first unused entry */
|
|
|
|
|
|
|
|
/*
|
|
|
|
* block compression parameters -- after all codes are used up,
|
|
|
|
* and compression rate changes, start over.
|
|
|
|
*/
|
|
|
|
static int clear_flg = 0;
|
|
|
|
|
|
|
|
static int offset;
|
|
|
|
static long int in_count = 1; /* length of input */
|
|
|
|
static long int out_count = 0; /* # of codes output (for debugging) */
|
|
|
|
|
|
|
|
/*
|
|
|
|
* compress stdin to stdout
|
|
|
|
*
|
|
|
|
* Algorithm: use open addressing double hashing (no chaining) on the
|
|
|
|
* prefix code / next character combination. We do a variant of Knuth's
|
|
|
|
* algorithm D (vol. 3, sec. 6.4) along with G. Knott's relatively-prime
|
|
|
|
* secondary probe. Here, the modular division first probe is gives way
|
|
|
|
* to a faster exclusive-or manipulation. Also do block compression with
|
|
|
|
* an adaptive reset, whereby the code table is cleared when the compression
|
|
|
|
* ratio decreases, but after the table fills. The variable-length output
|
|
|
|
* codes are re-sized at this point, and a special CLEAR code is generated
|
|
|
|
* for the decompressor. Late addition: construct the table according to
|
|
|
|
* file size for noticeable speed improvement on small files. Please direct
|
|
|
|
* questions about this implementation to ames!jaw.
|
|
|
|
*/
|
|
|
|
|
|
|
|
static int g_init_bits;
|
|
|
|
static FILE *g_outfile;
|
|
|
|
|
|
|
|
static int ClearCode;
|
|
|
|
static int EOFCode;
|
|
|
|
|
|
|
|
|
|
|
|
static unsigned long cur_accum;
|
|
|
|
static int cur_bits;
|
|
|
|
|
|
|
|
static unsigned long masks[] =
|
|
|
|
{0x0000, 0x0001, 0x0003, 0x0007, 0x000F,
|
|
|
|
0x001F, 0x003F, 0x007F, 0x00FF,
|
|
|
|
0x01FF, 0x03FF, 0x07FF, 0x0FFF,
|
|
|
|
0x1FFF, 0x3FFF, 0x7FFF, 0xFFFF};
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
compress (int init_bits,
|
|
|
|
FILE *outfile,
|
|
|
|
ifunptr ReadValue)
|
2003-07-29 06:52:41 +00:00
|
|
|
{
|
|
|
|
#ifdef GIF_UN
|
|
|
|
nocompress(init_bits, outfile, ReadValue);
|
|
|
|
#else
|
|
|
|
#ifdef GIF_RLE
|
|
|
|
rlecompress(init_bits, outfile, ReadValue);
|
|
|
|
#else
|
|
|
|
normalcompress(init_bits, outfile, ReadValue);
|
|
|
|
#endif
|
|
|
|
#endif
|
|
|
|
}
|
|
|
|
|
|
|
|
#ifdef GIF_UN
|
|
|
|
static void
|
|
|
|
nocompress (int init_bits,
|
|
|
|
FILE *outfile,
|
|
|
|
ifunptr ReadValue)
|
|
|
|
{
|
|
|
|
register long fcode;
|
|
|
|
register code_int i /* = 0 */ ;
|
|
|
|
register int c;
|
|
|
|
register code_int ent;
|
|
|
|
register code_int hsize_reg;
|
|
|
|
register int hshift;
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the globals: g_init_bits - initial number of bits
|
|
|
|
* g_outfile - pointer to output file
|
|
|
|
*/
|
|
|
|
g_init_bits = init_bits;
|
|
|
|
g_outfile = outfile;
|
|
|
|
|
|
|
|
cur_bits = 0;
|
|
|
|
cur_accum = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the necessary values
|
|
|
|
*/
|
|
|
|
offset = 0;
|
|
|
|
out_count = 0;
|
|
|
|
clear_flg = 0;
|
|
|
|
in_count = 1;
|
|
|
|
|
|
|
|
ClearCode = (1 << (init_bits - 1));
|
|
|
|
EOFCode = ClearCode + 1;
|
|
|
|
free_ent = ClearCode + 2;
|
|
|
|
|
|
|
|
|
|
|
|
/* Had some problems here... should be okay now. --Adam */
|
|
|
|
n_bits = g_init_bits;
|
|
|
|
maxcode = MAXCODE (n_bits);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
char_init ();
|
|
|
|
|
|
|
|
ent = GIFNextPixel (ReadValue);
|
|
|
|
|
|
|
|
hshift = 0;
|
|
|
|
for (fcode = (long) hsize; fcode < 65536L; fcode *= 2L)
|
|
|
|
++hshift;
|
|
|
|
hshift = 8 - hshift; /* set hash code range bound */
|
|
|
|
|
|
|
|
hsize_reg = hsize;
|
|
|
|
cl_hash ((count_int) hsize_reg); /* clear hash table */
|
|
|
|
|
|
|
|
output ((code_int) ClearCode);
|
|
|
|
|
|
|
|
|
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
while ((c = GIFNextPixel (ReadValue)) != (unsigned) EOF)
|
|
|
|
{
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
while ((c = GIFNextPixel (ReadValue)) != EOF)
|
|
|
|
{ /* } */
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
|
|
|
|
++in_count;
|
|
|
|
|
|
|
|
fcode = (long) (((long) c << maxbits) + ent);
|
|
|
|
i = (((code_int) c << hshift) ^ ent); /* xor hashing */
|
|
|
|
|
|
|
|
output ((code_int) ent);
|
|
|
|
++out_count;
|
|
|
|
ent = c;
|
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
if ((unsigned) free_ent < (unsigned) maxmaxcode)
|
|
|
|
{
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
if (free_ent < maxmaxcode)
|
|
|
|
{ /* } */
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
CodeTabOf (i) = free_ent++; /* code -> hashtable */
|
|
|
|
HashTabOf (i) = fcode;
|
|
|
|
}
|
|
|
|
else
|
|
|
|
cl_block ();
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Put out the final code.
|
|
|
|
*/
|
|
|
|
output ((code_int) ent);
|
|
|
|
++out_count;
|
|
|
|
output ((code_int) EOFCode);
|
|
|
|
}
|
|
|
|
#else
|
|
|
|
#ifdef GIF_RLE
|
|
|
|
|
|
|
|
static void
|
|
|
|
rlecompress (int init_bits,
|
|
|
|
FILE *outfile,
|
|
|
|
ifunptr ReadValue)
|
|
|
|
{
|
|
|
|
register long fcode;
|
|
|
|
register code_int i /* = 0 */ ;
|
|
|
|
register int c, last;
|
|
|
|
register code_int ent;
|
|
|
|
register code_int disp;
|
|
|
|
register code_int hsize_reg;
|
|
|
|
register int hshift;
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the globals: g_init_bits - initial number of bits
|
|
|
|
* g_outfile - pointer to output file
|
|
|
|
*/
|
|
|
|
g_init_bits = init_bits;
|
|
|
|
g_outfile = outfile;
|
|
|
|
|
|
|
|
cur_bits = 0;
|
|
|
|
cur_accum = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the necessary values
|
|
|
|
*/
|
|
|
|
offset = 0;
|
|
|
|
out_count = 0;
|
|
|
|
clear_flg = 0;
|
|
|
|
in_count = 1;
|
|
|
|
|
|
|
|
ClearCode = (1 << (init_bits - 1));
|
|
|
|
EOFCode = ClearCode + 1;
|
|
|
|
free_ent = ClearCode + 2;
|
|
|
|
|
|
|
|
|
|
|
|
/* Had some problems here... should be okay now. --Adam */
|
|
|
|
n_bits = g_init_bits;
|
|
|
|
maxcode = MAXCODE (n_bits);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
char_init ();
|
|
|
|
|
|
|
|
last = ent = GIFNextPixel (ReadValue);
|
|
|
|
|
|
|
|
hshift = 0;
|
|
|
|
for (fcode = (long) hsize; fcode < 65536L; fcode *= 2L)
|
|
|
|
++hshift;
|
|
|
|
hshift = 8 - hshift; /* set hash code range bound */
|
|
|
|
|
|
|
|
hsize_reg = hsize;
|
|
|
|
cl_hash ((count_int) hsize_reg); /* clear hash table */
|
|
|
|
|
|
|
|
output ((code_int) ClearCode);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
while ((c = GIFNextPixel (ReadValue)) != (unsigned) EOF)
|
|
|
|
{
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
while ((c = GIFNextPixel (ReadValue)) != EOF)
|
|
|
|
{ /* } */
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
|
|
|
|
++in_count;
|
|
|
|
|
|
|
|
fcode = (long) (((long) c << maxbits) + ent);
|
|
|
|
i = (((code_int) c << hshift) ^ ent); /* xor hashing */
|
|
|
|
|
|
|
|
|
|
|
|
if (last == c) {
|
|
|
|
if (HashTabOf (i) == fcode)
|
|
|
|
{
|
|
|
|
ent = CodeTabOf (i);
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
else if ((long) HashTabOf (i) < 0) /* empty slot */
|
|
|
|
goto nomatch;
|
|
|
|
disp = hsize_reg - i; /* secondary hash (after G. Knott) */
|
|
|
|
if (i == 0)
|
|
|
|
disp = 1;
|
|
|
|
probe:
|
|
|
|
if ((i -= disp) < 0)
|
|
|
|
i += hsize_reg;
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2003-07-29 06:52:41 +00:00
|
|
|
if (HashTabOf (i) == fcode)
|
|
|
|
{
|
|
|
|
ent = CodeTabOf (i);
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
if ((long) HashTabOf (i) > 0)
|
|
|
|
goto probe;
|
|
|
|
}
|
|
|
|
nomatch:
|
|
|
|
output ((code_int) ent);
|
|
|
|
++out_count;
|
|
|
|
last = ent = c;
|
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
if ((unsigned) free_ent < (unsigned) maxmaxcode)
|
|
|
|
{
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
if (free_ent < maxmaxcode)
|
|
|
|
{ /* } */
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
CodeTabOf (i) = free_ent++; /* code -> hashtable */
|
|
|
|
HashTabOf (i) = fcode;
|
|
|
|
}
|
|
|
|
else
|
|
|
|
cl_block ();
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Put out the final code.
|
|
|
|
*/
|
|
|
|
output ((code_int) ent);
|
|
|
|
++out_count;
|
|
|
|
output ((code_int) EOFCode);
|
|
|
|
}
|
|
|
|
|
|
|
|
#else
|
|
|
|
|
|
|
|
static void
|
|
|
|
normalcompress (int init_bits,
|
2004-07-21 17:06:18 +00:00
|
|
|
FILE *outfile,
|
|
|
|
ifunptr ReadValue)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
register long fcode;
|
|
|
|
register code_int i /* = 0 */ ;
|
|
|
|
register int c;
|
|
|
|
register code_int ent;
|
|
|
|
register code_int disp;
|
|
|
|
register code_int hsize_reg;
|
|
|
|
register int hshift;
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the globals: g_init_bits - initial number of bits
|
|
|
|
* g_outfile - pointer to output file
|
|
|
|
*/
|
|
|
|
g_init_bits = init_bits;
|
|
|
|
g_outfile = outfile;
|
|
|
|
|
|
|
|
cur_bits = 0;
|
|
|
|
cur_accum = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the necessary values
|
|
|
|
*/
|
|
|
|
offset = 0;
|
|
|
|
out_count = 0;
|
|
|
|
clear_flg = 0;
|
|
|
|
in_count = 1;
|
|
|
|
|
|
|
|
ClearCode = (1 << (init_bits - 1));
|
|
|
|
EOFCode = ClearCode + 1;
|
|
|
|
free_ent = ClearCode + 2;
|
|
|
|
|
|
|
|
|
|
|
|
/* Had some problems here... should be okay now. --Adam */
|
|
|
|
n_bits = g_init_bits;
|
|
|
|
maxcode = MAXCODE (n_bits);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
char_init ();
|
|
|
|
|
|
|
|
ent = GIFNextPixel (ReadValue);
|
|
|
|
|
|
|
|
hshift = 0;
|
|
|
|
for (fcode = (long) hsize; fcode < 65536L; fcode *= 2L)
|
|
|
|
++hshift;
|
|
|
|
hshift = 8 - hshift; /* set hash code range bound */
|
|
|
|
|
|
|
|
hsize_reg = hsize;
|
|
|
|
cl_hash ((count_int) hsize_reg); /* clear hash table */
|
|
|
|
|
|
|
|
output ((code_int) ClearCode);
|
|
|
|
|
|
|
|
|
2003-07-29 06:52:41 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
while ((c = GIFNextPixel (ReadValue)) != (unsigned) EOF)
|
|
|
|
{
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
while ((c = GIFNextPixel (ReadValue)) != EOF)
|
|
|
|
{ /* } */
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
|
|
|
|
++in_count;
|
|
|
|
|
|
|
|
fcode = (long) (((long) c << maxbits) + ent);
|
|
|
|
i = (((code_int) c << hshift) ^ ent); /* xor hashing */
|
|
|
|
|
|
|
|
if (HashTabOf (i) == fcode)
|
|
|
|
{
|
|
|
|
ent = CodeTabOf (i);
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
else if ((long) HashTabOf (i) < 0) /* empty slot */
|
|
|
|
goto nomatch;
|
|
|
|
disp = hsize_reg - i; /* secondary hash (after G. Knott) */
|
|
|
|
if (i == 0)
|
|
|
|
disp = 1;
|
|
|
|
probe:
|
|
|
|
if ((i -= disp) < 0)
|
|
|
|
i += hsize_reg;
|
|
|
|
|
|
|
|
if (HashTabOf (i) == fcode)
|
|
|
|
{
|
|
|
|
ent = CodeTabOf (i);
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
if ((long) HashTabOf (i) > 0)
|
|
|
|
goto probe;
|
|
|
|
nomatch:
|
|
|
|
output ((code_int) ent);
|
|
|
|
++out_count;
|
|
|
|
ent = c;
|
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
if ((unsigned) free_ent < (unsigned) maxmaxcode)
|
|
|
|
{
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
if (free_ent < maxmaxcode)
|
|
|
|
{ /* } */
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
CodeTabOf (i) = free_ent++; /* code -> hashtable */
|
|
|
|
HashTabOf (i) = fcode;
|
|
|
|
}
|
|
|
|
else
|
|
|
|
cl_block ();
|
|
|
|
}
|
2003-07-29 06:52:41 +00:00
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
/*
|
|
|
|
* Put out the final code.
|
|
|
|
*/
|
|
|
|
output ((code_int) ent);
|
|
|
|
++out_count;
|
|
|
|
output ((code_int) EOFCode);
|
|
|
|
}
|
2003-07-29 06:52:41 +00:00
|
|
|
#endif
|
|
|
|
#endif
|
|
|
|
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/*****************************************************************
|
|
|
|
* TAG( output )
|
|
|
|
*
|
|
|
|
* Output the given code.
|
|
|
|
* Inputs:
|
|
|
|
* code: A n_bits-bit integer. If == -1, then EOF. This assumes
|
|
|
|
* that n_bits =< (long)wordsize - 1.
|
|
|
|
* Outputs:
|
|
|
|
* Outputs code to the file.
|
|
|
|
* Assumptions:
|
|
|
|
* Chars are 8 bits long.
|
|
|
|
* Algorithm:
|
|
|
|
* Maintain a GIF_BITS character long buffer (so that 8 codes will
|
|
|
|
* fit in it exactly). Use the VAX insv instruction to insert each
|
|
|
|
* code in turn. When the buffer fills up empty it and start over.
|
|
|
|
*/
|
|
|
|
|
|
|
|
static void
|
|
|
|
output (code_int code)
|
|
|
|
{
|
|
|
|
cur_accum &= masks[cur_bits];
|
|
|
|
|
|
|
|
if (cur_bits > 0)
|
|
|
|
cur_accum |= ((long) code << cur_bits);
|
|
|
|
else
|
|
|
|
cur_accum = code;
|
|
|
|
|
|
|
|
cur_bits += n_bits;
|
|
|
|
|
|
|
|
while (cur_bits >= 8)
|
|
|
|
{
|
|
|
|
char_out ((unsigned int) (cur_accum & 0xff));
|
|
|
|
cur_accum >>= 8;
|
|
|
|
cur_bits -= 8;
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* If the next entry is going to be too big for the code size,
|
|
|
|
* then increase it, if possible.
|
|
|
|
*/
|
|
|
|
if (free_ent > maxcode || clear_flg)
|
|
|
|
{
|
|
|
|
|
|
|
|
if (clear_flg)
|
|
|
|
{
|
|
|
|
|
|
|
|
maxcode = MAXCODE (n_bits = g_init_bits);
|
|
|
|
clear_flg = 0;
|
|
|
|
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
|
|
|
|
++n_bits;
|
|
|
|
if (n_bits == maxbits)
|
|
|
|
maxcode = maxmaxcode;
|
|
|
|
else
|
|
|
|
maxcode = MAXCODE (n_bits);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
if (code == EOFCode)
|
|
|
|
{
|
|
|
|
/*
|
|
|
|
* At EOF, write the rest of the buffer.
|
|
|
|
*/
|
|
|
|
while (cur_bits > 0)
|
|
|
|
{
|
|
|
|
char_out ((unsigned int) (cur_accum & 0xff));
|
|
|
|
cur_accum >>= 8;
|
|
|
|
cur_bits -= 8;
|
|
|
|
}
|
|
|
|
|
|
|
|
flush_char ();
|
|
|
|
|
|
|
|
fflush (g_outfile);
|
|
|
|
|
|
|
|
if (ferror (g_outfile))
|
|
|
|
writeerr ();
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Clear out the hash table
|
|
|
|
*/
|
|
|
|
static void
|
2004-07-21 17:06:18 +00:00
|
|
|
cl_block (void) /* table clear for block compress */
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
cl_hash ((count_int) hsize);
|
|
|
|
free_ent = ClearCode + 2;
|
|
|
|
clear_flg = 1;
|
|
|
|
|
|
|
|
output ((code_int) ClearCode);
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
2004-07-21 17:06:18 +00:00
|
|
|
cl_hash (count_int hsize) /* reset code table */
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
|
|
|
|
register count_int *htab_p = htab + hsize;
|
|
|
|
|
|
|
|
register long i;
|
|
|
|
register long m1 = -1;
|
|
|
|
|
|
|
|
i = hsize - 16;
|
|
|
|
do
|
|
|
|
{ /* might use Sys V memset(3) here */
|
|
|
|
*(htab_p - 16) = m1;
|
|
|
|
*(htab_p - 15) = m1;
|
|
|
|
*(htab_p - 14) = m1;
|
|
|
|
*(htab_p - 13) = m1;
|
|
|
|
*(htab_p - 12) = m1;
|
|
|
|
*(htab_p - 11) = m1;
|
|
|
|
*(htab_p - 10) = m1;
|
|
|
|
*(htab_p - 9) = m1;
|
|
|
|
*(htab_p - 8) = m1;
|
|
|
|
*(htab_p - 7) = m1;
|
|
|
|
*(htab_p - 6) = m1;
|
|
|
|
*(htab_p - 5) = m1;
|
|
|
|
*(htab_p - 4) = m1;
|
|
|
|
*(htab_p - 3) = m1;
|
|
|
|
*(htab_p - 2) = m1;
|
|
|
|
*(htab_p - 1) = m1;
|
|
|
|
htab_p -= 16;
|
|
|
|
}
|
|
|
|
while ((i -= 16) >= 0);
|
|
|
|
|
|
|
|
for (i += 16; i > 0; --i)
|
|
|
|
*--htab_p = m1;
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
2004-07-21 17:06:18 +00:00
|
|
|
writeerr (void)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2003-06-13 14:37:00 +00:00
|
|
|
g_message (_("Error writing output file."));
|
1997-11-24 22:05:25 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
/******************************************************************************
|
|
|
|
*
|
|
|
|
* GIF Specific routines
|
|
|
|
*
|
|
|
|
******************************************************************************/
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Number of characters so far in this 'packet'
|
|
|
|
*/
|
|
|
|
static int a_count;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the 'byte output' routine
|
|
|
|
*/
|
|
|
|
static void
|
2004-07-21 17:06:18 +00:00
|
|
|
char_init (void)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
a_count = 0;
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Define the storage for the packet accumulator
|
|
|
|
*/
|
|
|
|
static char accum[256];
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Add a character to the end of the current packet, and if it is 254
|
|
|
|
* characters, flush the packet to disk.
|
|
|
|
*/
|
|
|
|
static void
|
|
|
|
char_out (int c)
|
|
|
|
{
|
|
|
|
accum[a_count++] = c;
|
|
|
|
if (a_count >= 254)
|
|
|
|
flush_char ();
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Flush the packet to disk, and reset the accumulator
|
|
|
|
*/
|
|
|
|
static void
|
2000-01-25 17:46:56 +00:00
|
|
|
flush_char (void)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
if (a_count > 0)
|
|
|
|
{
|
|
|
|
fputc (a_count, g_outfile);
|
|
|
|
fwrite (accum, 1, a_count, g_outfile);
|
|
|
|
a_count = 0;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/* Save interface functions */
|
|
|
|
|
|
|
|
static void
|
2001-09-09 19:54:37 +00:00
|
|
|
comment_entry_callback (GtkTextBuffer *buffer)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
2001-09-09 19:54:37 +00:00
|
|
|
GtkTextIter start_iter;
|
|
|
|
GtkTextIter end_iter;
|
|
|
|
gchar *text;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2001-09-09 19:54:37 +00:00
|
|
|
gtk_text_buffer_get_bounds (buffer, &start_iter, &end_iter);
|
|
|
|
text = gtk_text_buffer_get_text (buffer, &start_iter, &end_iter, FALSE);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
2001-09-09 19:54:37 +00:00
|
|
|
if (strlen (text) > 240)
|
2001-09-17 18:11:15 +00:00
|
|
|
{
|
|
|
|
g_message (_("The default comment is limited to %d characters."), 240);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2001-09-17 18:11:15 +00:00
|
|
|
gtk_text_buffer_get_iter_at_offset (buffer, &start_iter, 240 - 1);
|
|
|
|
gtk_text_buffer_get_end_iter (buffer, &end_iter);
|
2003-11-06 15:27:05 +00:00
|
|
|
|
2001-09-17 18:11:15 +00:00
|
|
|
/* this calls us recursivaly, but in the else branch
|
|
|
|
*/
|
|
|
|
gtk_text_buffer_delete (buffer, &start_iter, &end_iter);
|
2003-11-06 15:27:05 +00:00
|
|
|
}
|
2001-09-17 18:11:15 +00:00
|
|
|
else
|
|
|
|
{
|
|
|
|
g_free (globalcomment);
|
|
|
|
globalcomment = g_strdup (text);
|
|
|
|
comment_was_edited = TRUE;
|
|
|
|
}
|
1999-04-25 16:10:43 +00:00
|
|
|
|
2001-09-09 19:54:37 +00:00
|
|
|
g_free (text);
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|